diff options
| author | craig <craig@11d20701-8431-0410-a711-e3c959e3b870> | 2012-01-01 11:40:09 +0000 |
|---|---|---|
| committer | craig <craig@11d20701-8431-0410-a711-e3c959e3b870> | 2012-01-01 11:40:09 +0000 |
| commit | 7ed83b6c6666eb8b6b104c211ae7e52907350372 (patch) | |
| tree | 4430b556abac0ad660a0aacf1887d77f85d8be02 /scribus/plugins/import/pct | |
| download | scribus-7ed83b6c6666eb8b6b104c211ae7e52907350372.tar.gz scribus-7ed83b6c6666eb8b6b104c211ae7e52907350372.tar.xz scribus-7ed83b6c6666eb8b6b104c211ae7e52907350372.zip | |
Branch 1.3.5 tree to 1.4.x tree, goodbye 1.3.x
git-svn-id: svn://scribus.net/branches/Version14x/Scribus@17163 11d20701-8431-0410-a711-e3c959e3b870
Diffstat (limited to 'scribus/plugins/import/pct')
| -rw-r--r-- | scribus/plugins/import/pct/CMakeLists.txt | 30 | ||||
| -rw-r--r-- | scribus/plugins/import/pct/importpct.cpp | 2188 | ||||
| -rw-r--r-- | scribus/plugins/import/pct/importpct.h | 146 | ||||
| -rw-r--r-- | scribus/plugins/import/pct/importpctplugin.cpp | 155 | ||||
| -rw-r--r-- | scribus/plugins/import/pct/importpctplugin.h | 57 |
5 files changed, 2576 insertions, 0 deletions
diff --git a/scribus/plugins/import/pct/CMakeLists.txt b/scribus/plugins/import/pct/CMakeLists.txt new file mode 100644 index 0000000..740f065 --- /dev/null +++ b/scribus/plugins/import/pct/CMakeLists.txt @@ -0,0 +1,30 @@ +INCLUDE_DIRECTORIES( +${CMAKE_SOURCE_DIR} +${CMAKE_SOURCE_DIR}/scribus +) + +SET(IMPORTPCT_PLUGIN_MOC_CLASSES + importpct.h + importpctplugin.h +) + +SET(IMPORTPCT_PLUGIN_SOURCES + importpct.cpp + importpctplugin.cpp +) + +SET(SCRIBUS_IMPORTPCT_PLUGIN "importpct") + +QT4_WRAP_CPP(IMPORTPCT_PLUGIN_MOC_SOURCES ${IMPORTPCT_PLUGIN_MOC_CLASSES}) + +ADD_LIBRARY(${SCRIBUS_IMPORTPCT_PLUGIN} MODULE ${IMPORTPCT_PLUGIN_SOURCES} ${IMPORTPCT_PLUGIN_MOC_SOURCES}) + +TARGET_LINK_LIBRARIES(${SCRIBUS_IMPORTPCT_PLUGIN} ${PLUGIN_LIBRARIES}) + +INSTALL(TARGETS ${SCRIBUS_IMPORTPCT_PLUGIN} + LIBRARY + DESTINATION ${PLUGINDIR} + PERMISSIONS ${PLUGIN_PERMISSIONS} +) + +ADD_DEPENDENCIES(${SCRIBUS_IMPORTPCT_PLUGIN} ${EXE_NAME}) diff --git a/scribus/plugins/import/pct/importpct.cpp b/scribus/plugins/import/pct/importpct.cpp new file mode 100644 index 0000000..27756ba --- /dev/null +++ b/scribus/plugins/import/pct/importpct.cpp @@ -0,0 +1,2188 @@ +/*
+For general Scribus (>=1.3.2) copyright and licensing information please refer
+to the COPYING file provided with the program. Following this notice may exist
+a copyright and/or license notice that predates the release of Scribus 1.3.2
+for which a new license (GPL+exception) is in place.
+*/
+
+#include <QByteArray>
+#include <QCursor>
+#include <QDrag>
+#include <QFile>
+#include <QList>
+#include <QMimeData>
+#include <QRegExp>
+#include <QTextCodec>
+#include <QStack>
+#include <QDebug>
+
+#include <cstdlib>
+
+#include "commonstrings.h"
+#include "customfdialog.h"
+#include "importpct.h"
+#include "loadsaveplugin.h"
+#include "missing.h"
+#include "multiprogressdialog.h"
+#include "pageitem_imageframe.h"
+#include "pagesize.h"
+#include "prefscontext.h"
+#include "prefsfile.h"
+#include "prefsmanager.h"
+#include "prefstable.h"
+#include "propertiespalette.h"
+#include "rawimage.h"
+#include "scclocale.h"
+#include "sccolorengine.h"
+#include "scconfig.h"
+#include "scmimedata.h"
+#include "scpaths.h"
+#include "scpattern.h"
+#include "scribus.h"
+#include "scribusXml.h"
+#include "scribuscore.h"
+#include "sctextstream.h"
+#include "selection.h"
+#include "undomanager.h"
+#include "util.h"
+#include "util_formats.h"
+#include "util_icon.h"
+#include "util_math.h"
+
+extern SCRIBUS_API ScribusQApp * ScQApp;
+
+PctPlug::PctPlug(ScribusDoc* doc, int flags)
+{
+ tmpSel=new Selection(this, false);
+ m_Doc=doc;
+ importerFlags = flags;
+ interactive = (flags & LoadSavePlugin::lfInteractive);
+}
+
+bool PctPlug::import(QString fNameIn, const TransactionSettings& trSettings, int flags, bool showProgress)
+{
+ QString fName = fNameIn;
+ bool success = false;
+ interactive = (flags & LoadSavePlugin::lfInteractive);
+ importerFlags = flags;
+ cancel = false;
+ double x, y, b, h;
+ bool ret = false;
+ CustColors.clear();
+ QFileInfo fi = QFileInfo(fName);
+ if ( !ScCore->usingGUI() )
+ {
+ interactive = false;
+ showProgress = false;
+ }
+ baseFile = QDir::cleanPath(QDir::toNativeSeparators(fi.absolutePath()+"/"));
+ if ( showProgress )
+ {
+ ScribusMainWindow* mw=(m_Doc==0) ? ScCore->primaryMainWindow() : m_Doc->scMW();
+ progressDialog = new MultiProgressDialog( tr("Importing: %1").arg(fi.fileName()), CommonStrings::tr_Cancel, mw );
+ QStringList barNames, barTexts;
+ barNames << "GI";
+ barTexts << tr("Analyzing File:");
+ QList<bool> barsNumeric;
+ barsNumeric << false;
+ progressDialog->addExtraProgressBars(barNames, barTexts, barsNumeric);
+ progressDialog->setOverallTotalSteps(3);
+ progressDialog->setOverallProgress(0);
+ progressDialog->setProgress("GI", 0);
+ progressDialog->show();
+ connect(progressDialog, SIGNAL(canceled()), this, SLOT(cancelRequested()));
+ qApp->processEvents();
+ }
+ else
+ progressDialog = NULL;
+/* Set default Page to size defined in Preferences */
+ x = 0.0;
+ y = 0.0;
+ b = 0.0;
+ h = 0.0;
+ if (progressDialog)
+ {
+ progressDialog->setOverallProgress(1);
+ qApp->processEvents();
+ }
+ parseHeader(fName, x, y, b, h);
+ if (b == 0.0)
+ b = PrefsManager::instance()->appPrefs.PageWidth;
+ if (h == 0.0)
+ h = PrefsManager::instance()->appPrefs.PageHeight;
+ docWidth = b;
+ docHeight = h;
+ baseX = 0;
+ baseY = 0;
+ if (!interactive || (flags & LoadSavePlugin::lfInsertPage))
+ {
+ m_Doc->setPage(docWidth, docHeight, 0, 0, 0, 0, 0, 0, false, false);
+ m_Doc->addPage(0);
+ m_Doc->view()->addPage(0, true);
+ baseX = -x;
+ baseY = -y;
+ }
+ else
+ {
+ if (!m_Doc || (flags & LoadSavePlugin::lfCreateDoc))
+ {
+ m_Doc=ScCore->primaryMainWindow()->doFileNew(docWidth, docHeight, 0, 0, 0, 0, 0, 0, false, false, 0, false, 0, 1, "Custom", true);
+ ScCore->primaryMainWindow()->HaveNewDoc();
+ ret = true;
+ baseX = m_Doc->currentPage()->xOffset() - x;
+ baseY = m_Doc->currentPage()->yOffset() - y;
+ }
+ }
+ if ((!ret) && (interactive))
+ {
+ baseX = m_Doc->currentPage()->xOffset() - x;
+ baseY = m_Doc->currentPage()->yOffset() - y;
+ }
+ if ((ret) || (!interactive))
+ {
+ if (docWidth > docHeight)
+ m_Doc->PageOri = 1;
+ else
+ m_Doc->PageOri = 0;
+ m_Doc->m_pageSize = "Custom";
+ }
+ Elements.clear();
+ FPoint minSize = m_Doc->minCanvasCoordinate;
+ FPoint maxSize = m_Doc->maxCanvasCoordinate;
+ FPoint cOrigin = m_Doc->view()->canvasOrigin();
+ m_Doc->view()->Deselect();
+ m_Doc->setLoading(true);
+ m_Doc->DoDrawing = false;
+ m_Doc->view()->updatesOn(false);
+ m_Doc->scMW()->setScriptRunning(true);
+ qApp->changeOverrideCursor(QCursor(Qt::WaitCursor));
+ QString CurDirP = QDir::currentPath();
+ QDir::setCurrent(fi.path());
+ if (convert(fName))
+ {
+ tmpSel->clear();
+ QDir::setCurrent(CurDirP);
+ if ((Elements.count() > 1) && (!(importerFlags & LoadSavePlugin::lfCreateDoc)))
+ {
+ bool isGroup = true;
+ int firstElem = -1;
+ if (Elements.at(0)->Groups.count() != 0)
+ firstElem = Elements.at(0)->Groups.top();
+ for (int bx = 0; bx < Elements.count(); ++bx)
+ {
+ PageItem* bxi = Elements.at(bx);
+ if (bxi->Groups.count() != 0)
+ {
+ if (bxi->Groups.top() != firstElem)
+ isGroup = false;
+ }
+ else
+ isGroup = false;
+ }
+ if (!isGroup)
+ {
+ double minx = 99999.9;
+ double miny = 99999.9;
+ double maxx = -99999.9;
+ double maxy = -99999.9;
+ uint lowestItem = 999999;
+ uint highestItem = 0;
+ for (int a = 0; a < Elements.count(); ++a)
+ {
+ Elements.at(a)->Groups.push(m_Doc->GroupCounter);
+ PageItem* currItem = Elements.at(a);
+ lowestItem = qMin(lowestItem, currItem->ItemNr);
+ highestItem = qMax(highestItem, currItem->ItemNr);
+ double x1, x2, y1, y2;
+ currItem->getVisualBoundingRect(&x1, &y1, &x2, &y2);
+ minx = qMin(minx, x1);
+ miny = qMin(miny, y1);
+ maxx = qMax(maxx, x2);
+ maxy = qMax(maxy, y2);
+ }
+ double gx = minx;
+ double gy = miny;
+ double gw = maxx - minx;
+ double gh = maxy - miny;
+ PageItem *high = m_Doc->Items->at(highestItem);
+ int z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Rectangle, gx, gy, gw, gh, 0, m_Doc->toolSettings.dBrush, m_Doc->toolSettings.dPen, true);
+ PageItem *neu = m_Doc->Items->takeAt(z);
+ m_Doc->Items->insert(lowestItem, neu);
+ neu->Groups.push(m_Doc->GroupCounter);
+ neu->setItemName( tr("Group%1").arg(neu->Groups.top()));
+ neu->isGroupControl = true;
+ neu->groupsLastItem = high;
+ neu->setTextFlowMode(PageItem::TextFlowDisabled);
+ for (int a = 0; a < m_Doc->Items->count(); ++a)
+ {
+ m_Doc->Items->at(a)->ItemNr = a;
+ }
+ Elements.prepend(neu);
+ m_Doc->GroupCounter++;
+ }
+ }
+ m_Doc->DoDrawing = true;
+ m_Doc->scMW()->setScriptRunning(false);
+ m_Doc->setLoading(false);
+ qApp->changeOverrideCursor(QCursor(Qt::ArrowCursor));
+ if ((Elements.count() > 0) && (!ret) && (interactive))
+ {
+ if (flags & LoadSavePlugin::lfScripted)
+ {
+ bool loadF = m_Doc->isLoading();
+ m_Doc->setLoading(false);
+ m_Doc->changed();
+ m_Doc->setLoading(loadF);
+ m_Doc->m_Selection->delaySignalsOn();
+ for (int dre=0; dre<Elements.count(); ++dre)
+ {
+ m_Doc->m_Selection->addItem(Elements.at(dre), true);
+ }
+ m_Doc->m_Selection->delaySignalsOff();
+ m_Doc->m_Selection->setGroupRect();
+ m_Doc->view()->updatesOn(true);
+ }
+ else
+ {
+ m_Doc->DragP = true;
+ m_Doc->DraggedElem = 0;
+ m_Doc->DragElements.clear();
+ m_Doc->m_Selection->delaySignalsOn();
+ for (int dre=0; dre<Elements.count(); ++dre)
+ {
+ m_Doc->DragElements.append(Elements.at(dre)->ItemNr);
+ tmpSel->addItem(Elements.at(dre), true);
+ }
+ tmpSel->setGroupRect();
+ ScriXmlDoc *ss = new ScriXmlDoc();
+ ScElemMimeData* md = new ScElemMimeData();
+ md->setScribusElem(ss->WriteElem(m_Doc, m_Doc->view(), tmpSel));
+ delete ss;
+ m_Doc->itemSelection_DeleteItem(tmpSel);
+ m_Doc->view()->updatesOn(true);
+ if (importedColors.count() != 0)
+ {
+ for (int cd = 0; cd < importedColors.count(); cd++)
+ {
+ m_Doc->PageColors.remove(importedColors[cd]);
+ }
+ }
+ if (importedPatterns.count() != 0)
+ {
+ for (int cd = 0; cd < importedPatterns.count(); cd++)
+ {
+ m_Doc->docPatterns.remove(importedPatterns[cd]);
+ }
+ }
+ m_Doc->m_Selection->delaySignalsOff();
+ // We must copy the TransationSettings object as it is owned
+ // by handleObjectImport method afterwards
+ TransactionSettings* transacSettings = new TransactionSettings(trSettings);
+ m_Doc->view()->handleObjectImport(md, transacSettings);
+ m_Doc->DragP = false;
+ m_Doc->DraggedElem = 0;
+ m_Doc->DragElements.clear();
+ }
+ }
+ else
+ {
+ m_Doc->changed();
+ m_Doc->reformPages();
+ m_Doc->view()->updatesOn(true);
+ }
+ success = true;
+ }
+ else
+ {
+ QDir::setCurrent(CurDirP);
+ m_Doc->DoDrawing = true;
+ m_Doc->scMW()->setScriptRunning(false);
+ m_Doc->view()->updatesOn(true);
+ qApp->changeOverrideCursor(QCursor(Qt::ArrowCursor));
+ }
+ if (interactive)
+ m_Doc->setLoading(false);
+ //CB If we have a gui we must refresh it if we have used the progressbar
+ if ((showProgress) && (!interactive))
+ m_Doc->view()->DrawNew();
+ return success;
+}
+
+PctPlug::~PctPlug()
+{
+ if (progressDialog)
+ delete progressDialog;
+ delete tmpSel;
+}
+
+void PctPlug::parseHeader(QString fName, double &x, double &y, double &b, double &h)
+{
+ QFile f(fName);
+ if (f.open(QIODevice::ReadOnly))
+ {
+ QDataStream ts(&f);
+ ts.device()->seek(512);
+ qint16 pgX, pgY, pgW, pgH, dummy;
+ ts >> dummy >> pgX >> pgY >> pgW >> pgH;
+ h = pgW - pgX;
+ b = pgH - pgY;
+ x = pgY;
+ y = pgX;
+ f.close();
+// qDebug() << "W" << b << "H" << h;
+ }
+}
+
+bool PctPlug::convert(QString fn)
+{
+ QString tmp;
+ CurrColorFill = "White";
+ CurrFillShade = 100.0;
+ CurrColorStroke = "Black";
+ CurrStrokeShade = 100.0;
+ patternMode = false;
+ patternData.resize(0);
+ backColor = Qt::white;
+ foreColor = Qt::black;
+ Coords.resize(0);
+ Coords.svgInit();
+ LineW = 1.0;
+ currentPoint = QPoint(0, 0);
+ currentPointT = QPoint(0, 0);
+ ovalSize = QPoint(0, 0);
+ fontMap.clear();
+ currentTextSize = 12;
+ currentFontID = 0;
+ currentFontStyle = 0;
+ imageData.resize(0);
+ lineMode = false;
+ skipOpcode = false;
+ postscriptMode = false;
+ textIsPostScript = false;
+ importedColors.clear();
+ importedPatterns.clear();
+ QList<PageItem*> gElements;
+ groupStack.push(gElements);
+ currentItemNr = 0;
+ if(progressDialog)
+ {
+ progressDialog->setOverallProgress(2);
+ progressDialog->setLabel("GI", tr("Generating Items"));
+ qApp->processEvents();
+ }
+ QFile f(fn);
+ if (f.open(QIODevice::ReadOnly))
+ {
+ oldDocItemCount = m_Doc->Items->count();
+ int fSize = (int) f.size();
+ if (progressDialog)
+ {
+ progressDialog->setTotalSteps("GI", fSize);
+ qApp->processEvents();
+ }
+ QDataStream ts(&f);
+ ts.device()->seek(522);
+ quint16 vers = 0;
+ ts >> vers;
+ while (vers == 0)
+ {
+ ts >> vers;
+ if (vers == 0x00FF)
+ {
+ if (progressDialog)
+ progressDialog->close();
+ f.close();
+ return false;
+ }
+ }
+ if (vers == 0x1101)
+ {
+ pctVersion = 1; // Pict Version 1
+ parsePict(ts);
+ }
+ else
+ {
+ ts.skipRawData(4); // skip the next 4 Bytes
+ ts >> vers; // read the version info
+// if (vers == 0x0FFFE)
+ pctVersion = 2; // Pict Extended Version 2
+// else if (vers == 0x0FFFF)
+// pctVersion = 3; // Pict Version 2
+// else
+// {
+// if (progressDialog)
+// progressDialog->close();
+// f.close();
+// return false; // bail out, no Mac Pict
+// }
+ ts.skipRawData(22);
+ parsePict(ts);
+ }
+ if (Elements.count() == 0)
+ {
+ if (importedColors.count() != 0)
+ {
+ for (int cd = 0; cd < importedColors.count(); cd++)
+ {
+ m_Doc->PageColors.remove(importedColors[cd]);
+ }
+ }
+ if (importedPatterns.count() != 0)
+ {
+ for (int cd = 0; cd < importedPatterns.count(); cd++)
+ {
+ m_Doc->docPatterns.remove(importedPatterns[cd]);
+ }
+ }
+ }
+ f.close();
+ }
+ if (progressDialog)
+ progressDialog->close();
+ return true;
+}
+
+void PctPlug::parsePict(QDataStream &ts)
+{
+ while (!ts.atEnd())
+ {
+ quint16 opCode, dataLen;
+ quint8 dataLenByte;
+ quint32 dataLenLong;
+ if (pctVersion == 1)
+ {
+ ts >> dataLenByte;
+ opCode = dataLenByte;
+ }
+ else
+ ts >> opCode;
+ if (((opCode >= 0x0092) && (opCode <= 0x0097)) || ((opCode >= 0x009C) && (opCode <= 0x009F)) || ((opCode >= 0x00A2) && (opCode <= 0x00AF)))
+ {
+ // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ ts >> dataLen;
+ alignStreamToWord(ts, dataLen);
+ }
+ else if (((opCode >= 0x00B0) && (opCode <= 0x00CF)) || ((opCode >= 0x8000) && (opCode <= 0x80FF)))
+ {
+ // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ }
+ else if (((opCode >= 0x00D0) && (opCode <= 0x00FE)) || ((opCode >= 0x8100) && (opCode <= 0x81FF)))
+ {
+ // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ ts >> dataLenLong;
+ alignStreamToWord(ts, dataLenLong);
+ }
+ else if (((opCode >= 0x0100) && (opCode <= 0x01FF)) || ((opCode >= 0x02FF) && (opCode <= 0x0BFE)))
+ {
+ // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ alignStreamToWord(ts, 2);
+ }
+ else if ((opCode >= 0x0C00) && (opCode <= 0x7EFF))
+ {
+ // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ alignStreamToWord(ts, 24);
+ }
+ else if ((opCode >= 0x7F00) && (opCode <= 0x7FFF))
+ {
+ // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ alignStreamToWord(ts, 254);
+ }
+ else
+ {
+ switch (opCode)
+ {
+ case 0x0000: // NOP
+// qDebug() << "NOP";
+ break;
+ case 0x0001: // Clipping Region
+// qDebug() << "Clipping Region";
+ ts >> dataLen;
+ alignStreamToWord(ts, dataLen-2);
+ break;
+ case 0x0002: // Background Pattern
+ handleLineModeEnd();
+// qDebug() << "Background Pattern";
+ alignStreamToWord(ts, 8);
+ break;
+ case 0x0003: // Text Font
+ handleTextFont(ts);
+ break;
+ case 0x0004: // Text Style
+ handleTextStyle(ts);
+ break;
+ case 0x0005: // Text Mode
+ handleLineModeEnd();
+ ts >> dataLen;
+// qDebug() << "Text Mode" << dataLen;
+// alignStreamToWord(ts, 2);
+ break;
+ case 0x0006: // Extra Space
+// qDebug() << "Extra Space";
+ alignStreamToWord(ts, 4);
+ break;
+ case 0x0007: // Pen Size
+ handlePenSize(ts);
+ break;
+ case 0x0008: // Pen Mode
+ handleLineModeEnd();
+ ts >> dataLen;
+// qDebug() << "Pen Mode" << dataLen;
+// alignStreamToWord(ts, 2);
+ break;
+ case 0x0009: // Pen Pattern
+ handlePenPattern(ts);
+ break;
+ case 0x000A: // Fill Pattern
+ handleLineModeEnd();
+// qDebug() << "Fill Pattern";
+ alignStreamToWord(ts, 8);
+ break;
+ case 0x000B: // Oval Size
+ handleOvalSize(ts);
+ break;
+ case 0x000C: // Origin
+// qDebug() << "Origin";
+ alignStreamToWord(ts, 4);
+ break;
+ case 0x000D: // Text Size
+ handleTextSize(ts);
+ break;
+ case 0x000E: // Foreground Color
+ handleColor(ts, false);
+ break;
+ case 0x000F: // Background Color
+ handleColor(ts, true);
+ break;
+ case 0x0010: // Text Ratio
+ handleLineModeEnd();
+// qDebug() << "Text Ratio";
+ alignStreamToWord(ts, 8);
+ break;
+ case 0x0011: // Version
+// qDebug() << "Version";
+ alignStreamToWord(ts, 1);
+ break;
+ case 0x0015: // Fractional pen position
+ handleLineModeEnd();
+// qDebug() << "Fractional pen position at" << ts.device()->pos();
+ alignStreamToWord(ts, 2);
+ break;
+ case 0x0016: // Extra char space
+// qDebug() << "Extra char space";
+ alignStreamToWord(ts, 2);
+ break;
+ case 0x0017:
+ case 0x0018:
+ case 0x0019:
+// qDebug() << "Reserved by Apple";
+ break;
+ case 0x001A: // Foreground color RGB
+ handleColorRGB(ts, false);
+ break;
+ case 0x001B: // Background color RGB
+ handleColorRGB(ts, true);
+ break;
+ case 0x001C: // Highlight mode
+// qDebug() << "Highlight mode";
+ break;
+ case 0x001D: // Highlight color RGB
+// qDebug() << "Highlight color RGB";
+ alignStreamToWord(ts, 6);
+ break;
+ case 0x001E: // Use default highlight color
+// qDebug() << "Use default highlight color";
+ break;
+ case 0x0020: // Line
+ handleLine(ts);
+ break;
+ case 0x0021: // Line To
+ handleLineFrom(ts);
+ break;
+ case 0x0022: // Short Line
+ handleShortLine(ts);
+ break;
+ case 0x0023: // Short Line To
+ handleShortLineFrom(ts);
+ break;
+ case 0x0024:
+ case 0x0025:
+ case 0x0026:
+ case 0x0027: // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ ts >> dataLen;
+ alignStreamToWord(ts, dataLen);
+ break;
+ case 0x0028: // Long Text
+ handleLongText(ts);
+ break;
+ case 0x0029: // Text DH
+ handleDHText(ts);
+ break;
+ case 0x002A: // Text DV
+ handleDVText(ts);
+ break;
+ case 0x002B: // Text DHV
+ handleDHVText(ts);
+ break;
+ case 0x002C: // Font Name
+ handleFontName(ts);
+ break;
+ case 0x002D: // Line justify
+ handleLineModeEnd();
+// qDebug() << "Line justify";
+ alignStreamToWord(ts, 10);
+ break;
+ case 0x002E: // Glyph state
+ handleLineModeEnd();
+// qDebug() << "Glyph state";
+ ts >> dataLen;
+ alignStreamToWord(ts, dataLen);
+ break;
+ case 0x002F: // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ ts >> dataLen;
+ alignStreamToWord(ts, dataLen);
+ break;
+ case 0x0030: // Frame rect
+ case 0x0031: // Paint rect
+ case 0x0032: // Erase rect
+ case 0x0033: // Invert rect
+ case 0x0034: // Fill rect
+ handleShape(ts, opCode);
+ break;
+ case 0x0035:
+ case 0x0036:
+ case 0x0037: // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ alignStreamToWord(ts, 8);
+ break;
+ case 0x0038: // Frame same rect
+ case 0x0039: // Paint same rect
+ case 0x003A: // Erase same rect
+ case 0x003B: // Invert same rect
+ case 0x003C: // Fill same rect
+ handleSameShape(ts, opCode);
+ break;
+ case 0x003D:
+ case 0x003E:
+ case 0x003F: // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ break;
+ case 0x0040: // Frame round rect
+ case 0x0041: // Paint round rect
+ case 0x0042: // Erase round rect
+ case 0x0043: // Invert round rect
+ case 0x0044: // Fill round rect
+ handleShape(ts, opCode);
+ break;
+ case 0x0045:
+ case 0x0046:
+ case 0x0047: // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ alignStreamToWord(ts, 8);
+ break;
+ case 0x0048: // Frame same round rect
+ case 0x0049: // Paint same round rect
+ case 0x004A: // Erase same round rect
+ case 0x004B: // Invert same round rect
+ case 0x004C: // Fill same round rect
+ handleSameShape(ts, opCode);
+ break;
+ case 0x004D:
+ case 0x004E:
+ case 0x004F: // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ break;
+ case 0x0050: // Frame oval
+ case 0x0051: // Paint oval
+ case 0x0052: // Erase oval
+ case 0x0053: // Invert oval
+ case 0x0054: // Fill oval
+ handleShape(ts, opCode);
+ break;
+ case 0x0055:
+ case 0x0056:
+ case 0x0057: // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ alignStreamToWord(ts, 8);
+ break;
+ case 0x0058: // Frame same oval
+ case 0x0059: // Paint same oval
+ case 0x005A: // Erase same oval
+ case 0x005B: // Invert same oval
+ case 0x005C: // Fill same oval
+ handleSameShape(ts, opCode);
+ break;
+ case 0x005D:
+ case 0x005E:
+ case 0x005F: // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ break;
+ case 0x0060: // Frame arc
+ handleLineModeEnd();
+// qDebug() << "Frame arc";
+ alignStreamToWord(ts, 12);
+ break;
+ case 0x0061: // Paint arc
+ handleLineModeEnd();
+// qDebug() << "Paint arc";
+ alignStreamToWord(ts, 12);
+ break;
+ case 0x0062: // Erase arc
+ handleLineModeEnd();
+// qDebug() << "Erase arc";
+ alignStreamToWord(ts, 12);
+ break;
+ case 0x0063: // Invert arc
+ handleLineModeEnd();
+// qDebug() << "Invert arc";
+ alignStreamToWord(ts, 12);
+ break;
+ case 0x0064: // Fill arc
+ handleLineModeEnd();
+// qDebug() << "Fill arc";
+ alignStreamToWord(ts, 12);
+ break;
+ case 0x0065:
+ case 0x0066:
+ case 0x0067: // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ alignStreamToWord(ts, 12);
+ break;
+ case 0x0068: // Frame same arc
+ handleLineModeEnd();
+// qDebug() << "Frame same arc";
+ alignStreamToWord(ts, 4);
+ break;
+ case 0x0069: // Paint same arc
+ handleLineModeEnd();
+// qDebug() << "Paint same arc";
+ alignStreamToWord(ts, 4);
+ break;
+ case 0x006A: // Erase same arc
+ handleLineModeEnd();
+// qDebug() << "Erase same arc";
+ alignStreamToWord(ts, 4);
+ break;
+ case 0x006B: // Invert same arc
+ handleLineModeEnd();
+// qDebug() << "Invert same arc";
+ alignStreamToWord(ts, 4);
+ break;
+ case 0x006C: // Fill same arc
+ handleLineModeEnd();
+// qDebug() << "Fill same arc";
+ alignStreamToWord(ts, 4);
+ break;
+ case 0x006D:
+ case 0x006E:
+ case 0x006F: // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ alignStreamToWord(ts, 4);
+ break;
+ case 0x0070: // Frame poly
+ case 0x0071: // Paint poly
+ case 0x0072: // Erase poly
+ case 0x0073: // Invert poly
+ case 0x0074: // Fill poly
+ handlePolygon(ts, opCode);
+ break;
+ case 0x0075:
+ case 0x0076:
+ case 0x0077: // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ ts >> dataLen;
+ alignStreamToWord(ts, dataLen-2);
+ break;
+ case 0x0078: // Frame same poly
+ handleLineModeEnd();
+// qDebug() << "Frame same poly";
+ break;
+ case 0x0079: // Paint same poly
+ handleLineModeEnd();
+// qDebug() << "Paint same poly";
+ break;
+ case 0x007A: // Erase same poly
+ handleLineModeEnd();
+// qDebug() << "Erase same poly";
+ break;
+ case 0x007B: // Invert same poly
+ handleLineModeEnd();
+// qDebug() << "Invert same poly";
+ break;
+ case 0x007C: // Fill same poly
+ handleLineModeEnd();
+// qDebug() << "Fill same poly";
+ break;
+ case 0x007D:
+ case 0x007E:
+ case 0x007F: // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ break;
+ case 0x0080: // Frame region
+// qDebug() << "Frame region";
+ ts >> dataLen;
+ alignStreamToWord(ts, dataLen-2);
+ break;
+ case 0x0081: // Paint region
+ handleLineModeEnd();
+// qDebug() << "Paint region";
+ ts >> dataLen;
+ alignStreamToWord(ts, dataLen-2);
+ break;
+ case 0x0082: // Erase region
+ handleLineModeEnd();
+// qDebug() << "Erase region";
+ ts >> dataLen;
+ alignStreamToWord(ts, dataLen-2);
+ break;
+ case 0x0083: // Invert region
+ handleLineModeEnd();
+// qDebug() << "Invert region";
+ ts >> dataLen;
+ alignStreamToWord(ts, dataLen-2);
+ break;
+ case 0x0084: // Fill region
+ handleLineModeEnd();
+// qDebug() << "Fill region";
+ ts >> dataLen;
+ alignStreamToWord(ts, dataLen-2);
+ break;
+ case 0x0085:
+ case 0x0086:
+ case 0x0087: // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ ts >> dataLen;
+ alignStreamToWord(ts, dataLen-2);
+ break;
+ case 0x0088: // Frame same region
+ handleLineModeEnd();
+// qDebug() << "Frame same region";
+ break;
+ case 0x0089: // Paint same region
+ handleLineModeEnd();
+// qDebug() << "Paint same region";
+ break;
+ case 0x008A: // Erase same region
+ handleLineModeEnd();
+// qDebug() << "Erase same region";
+ break;
+ case 0x008B: // Invert same region
+ handleLineModeEnd();
+// qDebug() << "Invert same region";
+ break;
+ case 0x008C: // Fill same region
+ handleLineModeEnd();
+// qDebug() << "Fill same region";
+ break;
+ case 0x008D:
+ case 0x008E:
+ case 0x008F: // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ break;
+ case 0x0090: // Bits Rect
+// qDebug() << "Bits Rect";
+ handlePixmap(ts, opCode);
+ break;
+ case 0x0091: // Bits Region
+// qDebug() << "Bits Region";
+ handlePixmap(ts, opCode);
+ break;
+ case 0x0098: // Pack Bits Rect
+// qDebug() << "Pack Bits Rect";
+ handlePixmap(ts, opCode);
+ break;
+ case 0x0099: // Pack Bits Region
+// qDebug() << "Pack Bits Region";
+ handlePixmap(ts, opCode);
+ break;
+ case 0x009A: // Direct Bits Rect
+// qDebug() << "Direct Bits Rect";
+ handlePixmap(ts, opCode);
+ break;
+ case 0x009B: // Direct Bits Region
+// qDebug() << "Direct Bits Region";
+ handlePixmap(ts, opCode);
+ break;
+ case 0x00A0: // Short Comment
+ handleComment(ts, false);
+ break;
+ case 0x00A1: // Long Comment
+ handleComment(ts, true);
+ break;
+ case 0x00FF: // End of Pict
+ handleLineModeEnd();
+ if (imageData.size() > 0)
+ {
+ QImage image;
+ image.loadFromData(imageData);
+ image = image.convertToFormat(QImage::Format_ARGB32);
+ int z = m_Doc->itemAdd(PageItem::ImageFrame, PageItem::Unspecified, baseX, baseY, image.width(), image.height(), 0, CommonStrings::None, CommonStrings::None, true);
+ PageItem *ite = m_Doc->Items->at(z);
+ ite->tempImageFile = new QTemporaryFile(QDir::tempPath() + "/scribus_temp_pct_XXXXXX.png");
+ ite->tempImageFile->open();
+ QString fileName = getLongPathName(ite->tempImageFile->fileName());
+ ite->tempImageFile->close();
+ ite->isInlineImage = true;
+ image.save(fileName, "PNG");
+ ite->moveBy(m_Doc->currentPage()->xOffset(), m_Doc->currentPage()->yOffset());
+ finishItem(ite);
+ m_Doc->LoadPict(fileName, z);
+ ite->setImageScalingMode(false, false);
+ }
+// qDebug() << "End of Pict";
+ return;
+ break;
+ case 0x0200: // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ alignStreamToWord(ts, 4);
+ break;
+ case 0x8200: // Compressed QuickTime
+ case 0x8201: // Uncompressed QuickTime
+ handleQuickTime(ts, opCode);
+ break;
+ case 0xFFFF: // Reserved by Apple
+// qDebug() << "Reserved by Apple";
+ ts >> dataLenLong;
+ alignStreamToWord(ts, dataLenLong);
+ break;
+ default:
+// qDebug() << QString("Not implemented OpCode: 0x%1 at %2").arg(opCode, 4, 16, QLatin1Char('0')).arg(ts.device()->pos()-2);
+ return;
+ break;
+ }
+ }
+ if (progressDialog)
+ {
+ progressDialog->setProgress("GI", ts.device()->pos());
+ qApp->processEvents();
+ }
+ }
+}
+
+void PctPlug::alignStreamToWord(QDataStream &ts, uint len)
+{
+ ts.skipRawData(len);
+ if (pctVersion == 1)
+ return;
+ uint adj = ts.device()->pos() % 2;
+ if (adj != 0)
+ ts.skipRawData(1);
+}
+
+void PctPlug::handleColor(QDataStream &ts, bool back)
+{
+
+ handleLineModeEnd();
+ QString tmpName = CommonStrings::None;
+ ScColor tmp;
+ ColorList::Iterator it;
+ quint16 Rc, Gc, Bc;
+ quint32 colVal;
+ ts >> colVal;
+// qDebug() << "Color" << colVal << back;
+ switch (colVal)
+ {
+ case 30:
+ Rc = 0xFFFF;
+ Gc = 0xFFFF;
+ Bc = 0xFFFF;
+ break;
+ case 33:
+ Rc = 0x0000;
+ Gc = 0x0000;
+ Bc = 0x0000;
+ break;
+ case 69:
+ Rc = 0xFC00;
+ Gc = 0xF37D;
+ Bc = 0x052F;
+ break;
+ case 137:
+ Rc = 0xF2D7;
+ Gc = 0x0856;
+ Bc = 0x84EC;
+ break;
+ case 205:
+ Rc = 0xDD6B;
+ Gc = 0x08C2;
+ Bc = 0x06A2;
+ break;
+ case 273:
+ Rc = 0x0241;
+ Gc = 0xAB54;
+ Bc = 0xEAFF;
+ break;
+ case 341:
+ Rc = 0x0000;
+ Gc = 0x64AF;
+ Bc = 0x11B0;
+ break;
+ case 409:
+ Rc = 0x0000;
+ Gc = 0x0000;
+ Bc = 0xD400;
+ break;
+ default:
+ Rc = 0x0000;
+ Gc = 0x0000;
+ Bc = 0x0000;
+ break;
+ }
+ int redC, greenC, blueC, hR, hG, hB;
+ redC = qRound((Rc / 65535.0) * 255.0);
+ greenC = qRound((Gc / 65535.0) * 255.0);
+ blueC = qRound((Bc / 65535.0) * 255.0);
+ bool found = false;
+ QColor c = QColor(redC, greenC, blueC);
+ for (it = m_Doc->PageColors.begin(); it != m_Doc->PageColors.end(); ++it)
+ {
+ if (it.value().getColorModel() == colorModelRGB)
+ {
+ it.value().getRGB(&hR, &hG, &hB);
+ if ((redC == hR) && (greenC == hG) && (blueC == hB))
+ {
+ tmpName = it.key();
+ found = true;
+ break;
+ }
+ }
+ }
+ if (!found)
+ {
+ tmp.setColorRGB(redC, greenC, blueC);
+ tmp.setSpotColor(false);
+ tmp.setRegistrationColor(false);
+ tmpName = "FromPict"+c.name();
+ m_Doc->PageColors.insert(tmpName, tmp);
+ importedColors.append(tmpName);
+ }
+ if (back)
+ {
+ CurrColorFill = tmpName;
+ backColor = c;
+ }
+ else
+ {
+ CurrColorStroke = tmpName;
+ foreColor = c;
+ }
+}
+
+void PctPlug::handleColorRGB(QDataStream &ts, bool back)
+{
+ handleLineModeEnd();
+ QString tmpName = CommonStrings::None;
+ ScColor tmp;
+ ColorList::Iterator it;
+ quint16 Rc, Gc, Bc;
+ int redC, greenC, blueC, hR, hG, hB;
+ ts >> Rc >> Gc >> Bc;
+ redC = qRound((Rc / 65535.0) * 255.0);
+ greenC = qRound((Gc / 65535.0) * 255.0);
+ blueC = qRound((Bc / 65535.0) * 255.0);
+ bool found = false;
+ QColor c = QColor(redC, greenC, blueC);
+ for (it = m_Doc->PageColors.begin(); it != m_Doc->PageColors.end(); ++it)
+ {
+ if (it.value().getColorModel() == colorModelRGB)
+ {
+ it.value().getRGB(&hR, &hG, &hB);
+ if ((redC == hR) && (greenC == hG) && (blueC == hB))
+ {
+ tmpName = it.key();
+ found = true;
+ break;
+ }
+ }
+ }
+ if (!found)
+ {
+ tmp.setColorRGB(redC, greenC, blueC);
+ tmp.setSpotColor(false);
+ tmp.setRegistrationColor(false);
+ tmpName = "FromPict"+c.name();
+ m_Doc->PageColors.insert(tmpName, tmp);
+ importedColors.append(tmpName);
+ }
+ if (back)
+ {
+ CurrColorFill = tmpName;
+ backColor = c;
+ }
+ else
+ {
+ CurrColorStroke = tmpName;
+ foreColor = c;
+ }
+}
+
+void PctPlug::handlePenPattern(QDataStream &ts)
+{
+ handleLineModeEnd();
+ patternData.resize(8);
+ ts.readRawData(patternData.data(), 8);
+ patternMode = false;
+ for (int a = 0; a < patternData.size(); a++)
+ {
+ uchar d = patternData[a];
+ if ((d != 0x00) && (d != 0xFF))
+ {
+ patternMode = true;
+ break;
+ }
+ }
+}
+
+void PctPlug::handlePolygon(QDataStream &ts, quint16 opCode)
+{
+// qDebug() << "Handle Polygon";
+ handleLineModeEnd();
+ quint16 polySize;
+ ts >> polySize; // read polygon size
+ ts.skipRawData(8); // skip bounding rect;
+ polySize -= 14; // subtract size count, bounding rect and first point from size
+ qint16 x, y;
+ ts >> y >> x;
+ Coords.resize(0);
+ Coords.svgInit();
+ PageItem *ite;
+ Coords.svgMoveTo(x, y);
+ for(unsigned i = 0; i < polySize; i += 4)
+ {
+ ts >> y >> x;
+ Coords.svgLineTo(x, y);
+ }
+ if (Coords.size() > 0)
+ {
+ int z;
+ if (opCode == 0x0070)
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Unspecified, baseX, baseY, 10, 10, LineW, CommonStrings::None, CurrColorStroke, true);
+ else if (opCode == 0x0071)
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Unspecified, baseX, baseY, 10, 10, LineW, CurrColorStroke, CommonStrings::None, true);
+// else if (opCode == 0x0072)
+// z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Unspecified, baseX, baseY, 10, 10, LineW, CurrColorFill, CommonStrings::None, true);
+ else if (opCode == 0x0074)
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Unspecified, baseX, baseY, 10, 10, LineW, CurrColorStroke, CommonStrings::None, true);
+ else
+ {
+// qDebug() << QString("Not implemented OpCode: 0x%1").arg(opCode, 4, 16, QLatin1Char('0'));
+ return;
+ }
+ ite = m_Doc->Items->at(z);
+ ite->PoLine = Coords.copy();
+ ite->PoLine.translate(m_Doc->currentPage()->xOffset(), m_Doc->currentPage()->yOffset());
+ finishItem(ite);
+ if ((patternMode) && (opCode != 0x0070))
+ setFillPattern(ite);
+ }
+}
+
+void PctPlug::handleShape(QDataStream &ts, quint16 opCode)
+{
+ handleLineModeEnd();
+ QRect bounds = readRect(ts);
+// qDebug() << QString("Handle Rect/Oval 0x%1").arg(opCode, 4, 16, QLatin1Char('0'));
+ int z;
+ PageItem *ite;
+ if (opCode == 0x0030)
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Rectangle, baseX + bounds.x(), baseY + bounds.y(), bounds.width() - 1, bounds.height() - 1, LineW, CommonStrings::None, CurrColorStroke, true);
+ else if (opCode == 0x0031)
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Rectangle, baseX + bounds.x(), baseY + bounds.y(), bounds.width() - 1, bounds.height() - 1, 0, CurrColorStroke, CommonStrings::None, true);
+// else if (opCode == 0x0032)
+// z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Rectangle, baseX + bounds.x(), baseY + bounds.y(), bounds.width() - 1, bounds.height() - 1, 0, CurrColorFill, CommonStrings::None, true);
+ else if (opCode == 0x0034)
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Rectangle, baseX + bounds.x(), baseY + bounds.y(), bounds.width() - 1, bounds.height() - 1, 0, CurrColorStroke, CommonStrings::None, true);
+ else if (opCode == 0x0040)
+ {
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Rectangle, baseX + bounds.x(), baseY + bounds.y(), bounds.width() - 1, bounds.height() - 1, LineW, CommonStrings::None, CurrColorStroke, true);
+ ite = m_Doc->Items->at(z);
+ ite->setCornerRadius(qMax(ovalSize.x(), ovalSize.y()));
+ ite->SetFrameRound();
+ m_Doc->setRedrawBounding(ite);
+ }
+ else if (opCode == 0x0041)
+ {
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Rectangle, baseX + bounds.x(), baseY + bounds.y(), bounds.width() - 1, bounds.height() - 1, 0, CurrColorStroke, CommonStrings::None, true);
+ ite = m_Doc->Items->at(z);
+ ite->setCornerRadius(qMax(ovalSize.x(), ovalSize.y()));
+ ite->SetFrameRound();
+ m_Doc->setRedrawBounding(ite);
+ }
+// else if (opCode == 0x0042)
+// {
+// z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Rectangle, baseX + bounds.x(), baseY + bounds.y(), bounds.width() - 1, bounds.height() - 1, 0, CurrColorFill, CommonStrings::None, true);
+// ite = m_Doc->Items->at(z);
+// ite->setCornerRadius(qMax(ovalSize.x(), ovalSize.y()));
+// ite->SetFrameRound();
+// m_Doc->setRedrawBounding(ite);
+// }
+ else if (opCode == 0x0044)
+ {
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Rectangle, baseX + bounds.x(), baseY + bounds.y(), bounds.width() - 1, bounds.height() - 1, 0, CurrColorStroke, CommonStrings::None, true);
+ ite = m_Doc->Items->at(z);
+ ite->setCornerRadius(qMax(ovalSize.x(), ovalSize.y()));
+ ite->SetFrameRound();
+ m_Doc->setRedrawBounding(ite);
+ }
+ else if (opCode == 0x0050)
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Ellipse, baseX + bounds.x(), baseY + bounds.y(), bounds.width() - 1, bounds.height() - 1, LineW, CommonStrings::None, CurrColorStroke, true);
+ else if (opCode == 0x0051)
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Ellipse, baseX + bounds.x(), baseY + bounds.y(), bounds.width() - 1, bounds.height() - 1, 0, CurrColorStroke, CommonStrings::None, true);
+// else if (opCode == 0x0052)
+// z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Ellipse, baseX + bounds.x(), baseY + bounds.y(), bounds.width() - 1, bounds.height() - 1, 0, CurrColorFill, CommonStrings::None, true);
+ else if (opCode == 0x0054)
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Ellipse, baseX + bounds.x(), baseY + bounds.y(), bounds.width() - 1, bounds.height() - 1, 0, CurrColorStroke, CommonStrings::None, true);
+ else
+ {
+// qDebug() << QString("Not implemented OpCode: 0x%1").arg(opCode, 4, 16, QLatin1Char('0'));
+ return;
+ }
+ ite = m_Doc->Items->at(z);
+ ite->PoLine.translate(m_Doc->currentPage()->xOffset(), m_Doc->currentPage()->yOffset());
+ currRect = bounds;
+ currRectItemNr = z;
+ currRectType = 0;
+ if (opCode > 0x0044)
+ currRectType = 1;
+ finishItem(ite);
+ if ((patternMode) && ((opCode != 0x0030) || (opCode != 0x0040) || (opCode != 0x0050)))
+ setFillPattern(ite);
+}
+
+void PctPlug::handleSameShape(QDataStream &ts, quint16 opCode)
+{
+// qDebug() << QString("Handle Same Rect/Oval 0x%1").arg(opCode, 4, 16, QLatin1Char('0'));
+ int rectType = 0;
+ if (opCode > 0x0050)
+ rectType = 1;
+ handleLineModeEnd();
+ int z;
+ PageItem *ite;
+ if (currRectType == rectType)
+ {
+ ite = m_Doc->Items->at(currRectItemNr);
+ if ((opCode == 0x0038) || (opCode == 0x0048) || (opCode == 0x0058))
+ {
+ ite->setLineColor(CurrColorStroke);
+ ite->setLineWidth(LineW);
+ }
+// else if ((opCode == 0x003A) || (opCode == 0x004A) || (opCode == 0x005A))
+// ite->setFillColor(CurrColorFill);
+ else
+ ite->setFillColor(CurrColorStroke);
+ }
+ else
+ {
+ if (opCode == 0x0038)
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Rectangle, baseX + currRect.x(), baseY + currRect.y(), currRect.width() - 1, currRect.height() - 1, LineW, CommonStrings::None, CurrColorStroke, true);
+ else if (opCode == 0x0039)
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Rectangle, baseX + currRect.x(), baseY + currRect.y(), currRect.width() - 1, currRect.height() - 1, 0, CurrColorStroke, CommonStrings::None, true);
+// else if (opCode == 0x003A)
+// z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Rectangle, baseX + currRect.x(), baseY + currRect.y(), currRect.width() - 1, currRect.height() - 1, 0, CurrColorFill, CommonStrings::None, true);
+ else if (opCode == 0x003C)
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Rectangle, baseX + currRect.x(), baseY + currRect.y(), currRect.width() - 1, currRect.height() - 1, 0, CurrColorStroke, CommonStrings::None, true);
+ else if (opCode == 0x0048)
+ {
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Rectangle, baseX + currRect.x(), baseY + currRect.y(), currRect.width() - 1, currRect.height() - 1, 0, CommonStrings::None, CurrColorStroke, true);
+ ite = m_Doc->Items->at(z);
+ ite->setCornerRadius(qMax(ovalSize.x(), ovalSize.y()));
+ ite->SetFrameRound();
+ m_Doc->setRedrawBounding(ite);
+ }
+ else if (opCode == 0x0049)
+ {
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Rectangle, baseX + currRect.x(), baseY + currRect.y(), currRect.width() - 1, currRect.height() - 1, 0, CurrColorStroke, CommonStrings::None, true);
+ ite = m_Doc->Items->at(z);
+ ite->setCornerRadius(qMax(ovalSize.x(), ovalSize.y()));
+ ite->SetFrameRound();
+ m_Doc->setRedrawBounding(ite);
+ }
+// else if (opCode == 0x004A)
+// {
+// z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Rectangle, baseX + currRect.x(), baseY + currRect.y(), currRect.width() - 1, currRect.height() - 1, 0, CurrColorFill, CommonStrings::None, true);
+// ite = m_Doc->Items->at(z);
+// ite->setCornerRadius(qMax(ovalSize.x(), ovalSize.y()));
+// ite->SetFrameRound();
+// m_Doc->setRedrawBounding(ite);
+// }
+ else if (opCode == 0x004C)
+ {
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Rectangle, baseX + currRect.x(), baseY + currRect.y(), currRect.width() - 1, currRect.height() - 1, 0, CurrColorStroke, CommonStrings::None, true);
+ ite = m_Doc->Items->at(z);
+ ite->setCornerRadius(qMax(ovalSize.x(), ovalSize.y()));
+ ite->SetFrameRound();
+ m_Doc->setRedrawBounding(ite);
+ }
+ else if (opCode == 0x0058)
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Ellipse, baseX + currRect.x(), baseY + currRect.y(), currRect.width() - 1, currRect.height() - 1, LineW, CommonStrings::None, CurrColorStroke, true);
+ else if (opCode == 0x0059)
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Ellipse, baseX + currRect.x(), baseY + currRect.y(), currRect.width() - 1, currRect.height() - 1, 0, CurrColorStroke, CommonStrings::None, true);
+// else if (opCode == 0x005A)
+// z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Ellipse, baseX + currRect.x(), baseY + currRect.y(), currRect.width() - 1, currRect.height() - 1, 0, CurrColorFill, CommonStrings::None, true);
+ else if (opCode == 0x005C)
+ z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Ellipse, baseX + currRect.x(), baseY + currRect.y(), currRect.width() - 1, currRect.height() - 1, 0, CurrColorStroke, CommonStrings::None, true);
+ else
+ {
+// qDebug() << QString("Not implemented OpCode: 0x%1").arg(opCode, 4, 16, QLatin1Char('0'));
+ return;
+ }
+ ite = m_Doc->Items->at(z);
+ ite->PoLine.translate(m_Doc->currentPage()->xOffset(), m_Doc->currentPage()->yOffset());
+ finishItem(ite);
+ }
+ if ((patternMode) && ((opCode != 0x0038) || (opCode != 0x0048) || (opCode != 0x0058)))
+ setFillPattern(ite);
+}
+
+void PctPlug::handleFontName(QDataStream &ts)
+{
+ handleLineModeEnd();
+ quint16 dataLen, fontID;
+ quint8 nameLen;
+ ts >> dataLen >> fontID;
+ ts >> nameLen;
+ QByteArray fontRawName;
+ fontRawName.resize(nameLen);
+ ts.readRawData(fontRawName.data(), nameLen);
+ QString fontName = fontRawName;
+ fontName = fontName.simplified();
+ SCFonts fonts = PrefsManager::instance()->appPrefs.AvailFonts;
+ SCFontsIterator it(fonts);
+ for ( ; it.hasNext() ; it.next())
+ {
+
+ if (fonts[it.currentKey()].scName().simplified() == fontName)
+ {
+ fontName = fonts[it.currentKey()].family();
+ break;
+ }
+ }
+ fontMap.insert(fontID, fontName);
+ alignStreamToWord(ts, 0);
+// qDebug() << "Handle FontName" << fontName << "ID" << fontID;
+}
+
+void PctPlug::handleTextSize(QDataStream &ts)
+{
+ handleLineModeEnd();
+ quint16 fontSize;
+ ts >> fontSize;
+ currentTextSize = fontSize;
+// qDebug() << "Handle Text Size" << fontSize;
+}
+
+void PctPlug::handleTextFont(QDataStream &ts)
+{
+ handleLineModeEnd();
+ quint16 fontID;
+ ts >> fontID;
+ currentFontID = fontID;
+// qDebug() << "Handle Text Font" << fontID;
+}
+
+void PctPlug::handleTextStyle(QDataStream &ts)
+{
+ handleLineModeEnd();
+ quint8 style;
+ ts >> style;
+ alignStreamToWord(ts, 0);
+ currentFontStyle = style;
+// qDebug() << "Text Style" << style;
+}
+
+void PctPlug::handleLongText(QDataStream &ts)
+{
+ handleLineModeEnd();
+ quint8 textLen;
+ qint16 x, y;
+ ts >> y >> x;
+ ts >> textLen;
+ QByteArray text;
+ text.resize(textLen);
+ ts.readRawData(text.data(), textLen);
+ if (!textIsPostScript)
+ {
+ currentPointT = QPoint(x, y);
+ createTextPath(text);
+// qDebug() << "Handle Long Text at" << x << y << text;
+ }
+ alignStreamToWord(ts, 0);
+}
+
+void PctPlug::handleDHText(QDataStream &ts)
+{
+ handleLineModeEnd();
+ quint8 textLen, dh;
+ ts >> dh >> textLen;
+ QByteArray text;
+ text.resize(textLen);
+ ts.readRawData(text.data(), textLen);
+ if (!textIsPostScript)
+ {
+ QPoint s = currentPointT;
+ currentPointT = QPoint(s.x()+dh, s.y());
+ createTextPath(text);
+// qDebug() << "Handle DH Text at" << currentPointT << text;
+ }
+ alignStreamToWord(ts, 0);
+}
+
+void PctPlug::handleDVText(QDataStream &ts)
+{
+ handleLineModeEnd();
+ quint8 textLen, dv;
+ ts >> dv >> textLen;
+ QByteArray text;
+ text.resize(textLen);
+ ts.readRawData(text.data(), textLen);
+ if (!textIsPostScript)
+ {
+ QPoint s = currentPointT;
+ currentPointT = QPoint(s.x(), s.y()+dv);
+ createTextPath(text);
+// qDebug() << "Handle DV Text at" << currentPointT << text;
+ }
+ alignStreamToWord(ts, 0);
+}
+
+void PctPlug::handleDHVText(QDataStream &ts)
+{
+ handleLineModeEnd();
+ quint8 textLen, dv, dh;
+ ts >> dh >> dv >> textLen;
+ QByteArray text;
+ text.resize(textLen);
+ ts.readRawData(text.data(), textLen);
+ if (!textIsPostScript)
+ {
+ QPoint s = currentPointT;
+ currentPointT = QPoint(s.x()+dh, s.y()+dv);
+ createTextPath(text);
+// qDebug() << "Handle DHV Text" << dh << dv << "->" << currentPointT << text;
+ }
+ alignStreamToWord(ts, 0);
+}
+
+void PctPlug::createTextPath(QByteArray textString)
+{
+ QTextCodec *codec = QTextCodec::codecForName("Apple Roman");
+ QString string = codec->toUnicode(textString);
+ QFont textFont;
+ if (!fontMap.contains(currentFontID))
+ textFont = QFont();
+ else
+ {
+ QString fontName = fontMap[currentFontID];
+ textFont = QFont(fontName, currentTextSize);
+ QFontInfo inf(textFont);
+// qDebug() << "Using Font" << inf.family() << "for" << fontName;
+ }
+ textFont.setPixelSize(currentTextSize);
+ if (currentFontStyle & 1)
+ textFont.setBold(true);
+ if (currentFontStyle & 2)
+ textFont.setItalic(true);
+ if (currentFontStyle & 4)
+ textFont.setUnderline(true);
+ FPointArray textPath;
+ QPainterPath painterPath;
+ painterPath.addText( currentPointT.x(), currentPointT.y(), textFont, string);
+ textPath.fromQPainterPath(painterPath);
+ if (textPath.size() > 0)
+ {
+ int z = m_Doc->itemAdd(PageItem::Polygon, PageItem::Unspecified, baseX, baseY, 10, 10, 0, CurrColorStroke, CommonStrings::None, true);
+ PageItem* ite = m_Doc->Items->at(z);
+ ite->PoLine = textPath;
+ ite->PoLine.translate(m_Doc->currentPage()->xOffset(), m_Doc->currentPage()->yOffset());
+ finishItem(ite);
+ if (patternMode)
+ setFillPattern(ite);
+ }
+}
+
+void PctPlug::handlePenSize(QDataStream &ts)
+{
+// qDebug() << "Handle Pen Size";
+ handleLineModeEnd();
+ quint16 x, y;
+ ts >> y >> x;
+ LineW = qMax(x, y);
+}
+
+void PctPlug::handleOvalSize(QDataStream &ts)
+{
+// qDebug() << "Handle Oval Size";
+ handleLineModeEnd();
+ quint16 x, y;
+ ts >> y >> x;
+ ovalSize = QPoint(x, y);
+}
+
+void PctPlug::handleShortLine(QDataStream &ts)
+{
+ quint16 x, y;
+ qint8 dh, dv;
+ ts >> y >> x;
+ ts >> dh >> dv;
+ if ((dh == 0) && (dv == 0))
+ {
+ handleLineModeEnd();
+ Coords.svgMoveTo(x, y);
+ currentPoint = QPoint(x, y);
+ return;
+ }
+ QPoint s = QPoint(x, y);
+ if (currentPoint != s)
+ {
+ handleLineModeEnd();
+ Coords.svgMoveTo(x, y);
+ }
+ Coords.svgLineTo(x+dh, y+dv);
+ currentPoint = QPoint(x+dh, y+dv);
+ lineMode = true;
+// qDebug() << "Handle Short Line" << x << y << "+" << dh << dv << "->" << currentPoint;
+}
+
+void PctPlug::handleShortLineFrom(QDataStream &ts)
+{
+ qint8 dh, dv;
+ ts >> dh >> dv;
+ if ((dh == 0) && (dv == 0))
+ return;
+ QPoint s = currentPoint;
+ if (Coords.size() == 0)
+ Coords.svgMoveTo(s.x(), s.y());
+ Coords.svgLineTo(s.x()+dh, s.y()+dv);
+ currentPoint = QPoint(s.x()+dh, s.y()+dv);
+ lineMode = true;
+// qDebug() << "Handle Short Line from" << dh << dv << "->" << currentPoint;
+}
+
+void PctPlug::handleLine(QDataStream &ts)
+{
+ qint16 x1, x2, y1, y2;
+ ts >> y1 >> x1;
+ ts >> y2 >> x2;
+ QPoint s = QPoint(x1, y1);
+ if (currentPoint != s)
+ {
+ handleLineModeEnd();
+ Coords.svgMoveTo(x1, y1);
+ }
+ Coords.svgLineTo(x2, y2);
+ currentPoint = QPoint(x2, y2);
+ lineMode = true;
+// qDebug() << "Handle Line" << x1 << y1 << "->" << currentPoint;
+}
+
+void PctPlug::handleLineFrom(QDataStream &ts)
+{
+ qint16 x, y;
+ ts >> y >> x;
+ if ((x == 0) && (y == 0))
+ return;
+ QPoint s = currentPoint;
+ if (Coords.size() == 0)
+ Coords.svgMoveTo(s.x(), s.y());
+ Coords.svgLineTo(x, y);
+ currentPoint = QPoint(x, y);
+ lineMode = true;
+// qDebug() << "Handle Line from" << s << "->" << currentPoint;
+}
+
+void PctPlug::handlePixmap(QDataStream &ts, quint16 opCode)
+{
+ handleLineModeEnd();
+ quint16 bytesPerLine, packType, pixel_type, bits_per_pixel, component_count, component_size;
+ quint32 packSize, horizontal_resolution, vertical_resolution, color_table, plane_bytes;
+ if ((opCode == 0x009A) || (opCode == 0x009B))
+ ts.skipRawData(4);
+ ts >> bytesPerLine;
+ QRect bounds = readRect(ts);
+ bool isPixmap = bytesPerLine & 0x8000;
+ bytesPerLine &= 0x7FFF;
+// qDebug() << "Bytes per Line" << bytesPerLine << "Pixmap" << isPixmap;
+// qDebug() << "Bounds" << bounds.right() - bounds.left() << bounds.bottom() - bounds.top();
+ QVector<QRgb> colors;
+ if (isPixmap)
+ {
+ ts.skipRawData(2); // skip Version info, always 0
+ ts >> packType;
+ ts >> packSize;
+ ts >> horizontal_resolution >> vertical_resolution;
+ ts >> pixel_type >> bits_per_pixel >> component_count >> component_size;
+ ts >> plane_bytes >> color_table;
+ ts.skipRawData(4);
+// qDebug() << "Pack Type" << packType;
+// qDebug() << "Pack Size" << packSize;
+// qDebug() << "Pixel Type" << pixel_type;
+// qDebug() << "Bits per Pixel" << bits_per_pixel;
+// qDebug() << "Component Count" << component_count << "Size" << component_size;
+ // now reading color Table
+ if ((opCode != 0x009A) && (opCode != 0x009B))
+ {
+ quint32 ct_seed;
+ quint16 ct_flags, ct_size;
+ ts >> ct_seed;
+ ts >> ct_flags >> ct_size;
+// qDebug() << "ColorTable has" << ct_size << "Entries";
+ for (quint16 cc = 0; cc < ct_size+1; cc++)
+ {
+ quint16 cev, cRed, cGreen, cBlue;
+ ts >> cev >> cRed >> cGreen >> cBlue;
+ colors.append(qRgb(cRed, cGreen, cBlue));
+ }
+ }
+ }
+// reading scrRect
+ QRect scrRect = readRect(ts);
+// qDebug() << "Src Rect" << scrRect;
+// reading dstRect
+ QRect dstRect = readRect(ts);
+// qDebug() << "Dst Rect" << dstRect;
+ ts.skipRawData(2);
+ if ((opCode == 0x0091) || (opCode == 0x0099) || (opCode == 0x009B))
+ {
+ quint16 dataLen;
+ ts >> dataLen;
+ alignStreamToWord(ts, dataLen-2);
+ }
+ quint16 pixRows = bounds.bottom() - bounds.top();
+ quint16 pixCols = bounds.right() - bounds.left();
+ quint16 imgRows = dstRect.bottom() - dstRect.top();
+ quint16 imgCols = dstRect.right() - dstRect.left();
+ QImage image;
+ if (isPixmap)
+ {
+ if (component_count == 1)
+ {
+ image = QImage(pixCols, pixRows, QImage::Format_Indexed8);
+ image.setColorTable(colors);
+ }
+ else
+ image = QImage(pixCols, pixRows, QImage::Format_ARGB32);
+ }
+ else
+ image = QImage(pixCols, pixRows, QImage::Format_Mono);
+ for (quint16 rr = 0; rr < pixRows; rr++)
+ {
+ quint16 pixByteCount;
+ if (bytesPerLine < 250)
+ {
+ quint8 byteCount;
+ ts >> byteCount;
+ pixByteCount = byteCount;
+ }
+ else
+ ts >> pixByteCount;
+ if (!skipOpcode)
+ {
+ QByteArray data;
+ data.resize(pixByteCount);
+ ts.readRawData(data.data(), pixByteCount);
+ int twoByte = 1;
+ if (component_size == 5)
+ twoByte = 2;
+ QByteArray img;
+ if (bytesPerLine < 8)
+ img = data;
+ else
+ img = decodeRLE(data, bytesPerLine, twoByte);
+ if ((opCode == 0x0098) || (opCode == 0x0099))
+ {
+ if (!isPixmap)
+ {
+ memcpy(image.scanLine(rr), img.data(), bytesPerLine);
+ }
+ else if (component_count == 1)
+ {
+ if (component_size == 4)
+ {
+ uchar *q = (uchar*)(image.scanLine(rr));
+ for (int xx = 0; xx < img.size(); xx++)
+ {
+ uchar i = (img[xx] >> 4) & 0x0F;
+ uchar j = img[xx] & 0x0F;
+ *q++ = i;
+ *q++ = j;
+ }
+ }
+ else
+ memcpy(image.scanLine(rr), img.data(), bytesPerLine);
+ }
+ }
+ else if ((opCode == 0x009A) || (opCode == 0x009B))
+ {
+ if (component_size == 5)
+ {
+ QRgb *q = (QRgb*)(image.scanLine(rr));
+ int imgDcount = 0;
+ for (quint16 xx = 0; xx < pixCols; xx++)
+ {
+ uchar i = img[imgDcount++];
+ uchar j = img[imgDcount++];
+ quint16 r = (i & 0x7c) << 1;
+ quint16 g = ((i & 0x03) << 6) | ((j & 0xe0) >> 2);
+ quint16 b = (j & 0x1f) << 3;
+ *q++ = qRgba(r, g, b, 255);
+ }
+ }
+ else if (component_size == 8)
+ {
+ QRgb *q = (QRgb*)(image.scanLine(rr));
+ for (uint xx = 0; xx < (uint) pixCols; xx++)
+ {
+ uchar r, g, b;
+ uchar a = 255;
+ if (component_count == 3)
+ {
+ r = img[xx];
+ g = img[xx + pixCols];
+ b = img[xx + 2 * pixCols];
+ }
+ else if (component_count == 4)
+ {
+ a = 255 - img[xx];
+ r = img[xx + pixCols];
+ g = img[xx + 2 * pixCols];
+ b = img[xx + 3 * pixCols];
+ }
+ *q++ = qRgba(r, g, b, a);
+ }
+ }
+ }
+ }
+ else
+ {
+ ts.skipRawData(pixByteCount);
+ }
+ }
+ if (skipOpcode)
+ {
+ image.loadFromData(imageData);
+ isPixmap = true;
+ imageData.resize(0);
+ }
+ if ((component_size == 8) || (component_size == 1) || (component_size == 5) || (component_size == 4) || (!isPixmap) || (skipOpcode))
+ {
+ image = image.convertToFormat(QImage::Format_ARGB32);
+ if (!isPixmap)
+ image.invertPixels();
+ int z = m_Doc->itemAdd(PageItem::ImageFrame, PageItem::Unspecified, baseX + dstRect.left(), baseY + dstRect.top(), imgCols, imgRows, 0, CommonStrings::None, CommonStrings::None, true);
+ PageItem *ite = m_Doc->Items->at(z);
+ ite->tempImageFile = new QTemporaryFile(QDir::tempPath() + "/scribus_temp_pct_XXXXXX.png");
+ ite->tempImageFile->open();
+ QString fileName = getLongPathName(ite->tempImageFile->fileName());
+ ite->tempImageFile->close();
+ ite->isInlineImage = true;
+ image.save(fileName, "PNG");
+ ite->moveBy(m_Doc->currentPage()->xOffset(), m_Doc->currentPage()->yOffset());
+ finishItem(ite);
+ m_Doc->LoadPict(fileName, z);
+ ite->setImageScalingMode(false, false);
+ skipOpcode = false;
+ }
+ alignStreamToWord(ts, 0);
+}
+
+void PctPlug::handleQuickTime(QDataStream &ts, quint16 opCode)
+{
+// qDebug() << "Handle QuickTime Data";
+ quint32 dataLenLong, matteSize, maskSize, dataLen;
+ quint16 mode;
+ ts >> dataLenLong;
+ uint pos = ts.device()->pos();
+ handleLineModeEnd();
+ alignStreamToWord(ts, 38); // Skip version and Matrix information
+ ts >> matteSize;
+ QRect matteRect = readRect(ts);
+ if (opCode == 0x8200)
+ {
+ ts >> mode;
+ QRect srcRect = readRect(ts);
+ alignStreamToWord(ts, 4);
+ ts >> maskSize;
+ if (matteSize != 0)
+ {
+ ts >> dataLen;
+ alignStreamToWord(ts, dataLen);
+ alignStreamToWord(ts, matteSize);
+ }
+ if (maskSize != 0)
+ {
+ ts >> dataLen;
+ alignStreamToWord(ts, dataLen);
+ alignStreamToWord(ts, maskSize);
+ }
+ quint32 cType, vendor, dummyLong, imgDataSize;
+ quint16 width, height, dummyShort;
+ ts >> dataLen;
+ ts >> cType;
+ if (cType == 0x6A706567)
+ {
+ ts >> dummyLong;
+ ts >> dummyShort;
+ ts >> dummyShort;
+ ts >> dummyShort;
+ ts >> dummyShort;
+ ts >> vendor;
+ ts >> dummyLong;
+ ts >> dummyLong;
+ ts >> width;
+ ts >> height;
+ ts >> dummyLong;
+ ts >> dummyLong;
+ ts >> imgDataSize;
+ alignStreamToWord(ts, 38);
+ imageData.resize(imgDataSize);
+ ts.readRawData(imageData.data(), imgDataSize);
+ skipOpcode = true;
+ }
+ }
+ else
+ {
+ if (matteSize != 0)
+ {
+ ts >> dataLen;
+ alignStreamToWord(ts, dataLen);
+ alignStreamToWord(ts, matteSize);
+ }
+ ts >> mode;
+ handlePixmap(ts, mode);
+ skipOpcode = true;
+ }
+ ts.device()->seek(pos + dataLenLong);
+// qDebug() << "File Pos" << ts.device()->pos();
+}
+
+void PctPlug::handleComment(QDataStream &ts, bool longComment)
+{
+ quint16 commentCode;
+ handleLineModeEnd();
+ ts >> commentCode;
+ switch (commentCode)
+ {
+ case 100: // picAppComment
+// qDebug() << "Comment type: picAppComment";
+ break;
+ case 130: // picDwgBeg
+// qDebug() << "Comment type: picDwgBeg";
+ break;
+ case 131: // picDwgEnd
+// qDebug() << "Comment type: picDwgEnd";
+ break;
+ case 140: // picGrpBeg
+// qDebug() << "Comment type: picGrpBeg";
+ break;
+ case 141: // picGrpEnd
+// qDebug() << "Comment type: picGrpEnd";
+ break;
+ case 142: // picBitBeg
+// qDebug() << "Comment type: picBitBeg";
+ break;
+ case 143: // picBitEnd
+// qDebug() << "Comment type: picBitEnd";
+ break;
+ case 150: // TextBegin
+// qDebug() << "Comment type: TextBegin";
+ break;
+ case 151: // TextEnd
+// qDebug() << "Comment type: TextEnd";
+ break;
+ case 152: // StringBegin
+// qDebug() << "Comment type: StringBegin";
+ break;
+ case 153: // StringEnd
+// qDebug() << "Comment type: StringEnd";
+ break;
+ case 154: // TextCenter
+// qDebug() << "Comment type: TextCenter";
+ break;
+ case 155: // LineLayoutOff
+// qDebug() << "Comment type: LineLayoutOff";
+ break;
+ case 156: // LineLayoutOn
+// qDebug() << "Comment type: LineLayoutOn";
+ break;
+ case 157: // ClientLineLayout
+// qDebug() << "Comment type: ClientLineLayout";
+ break;
+ case 160: // PolyBegin
+// qDebug() << "Comment type: PolyBegin";
+ break;
+ case 161: // PolyEnd
+// qDebug() << "Comment type: PolyEnd";
+ break;
+ case 163: // PolyIgnore
+// qDebug() << "Comment type: PolyIgnore";
+ break;
+ case 164: // PolySmooth
+// qDebug() << "Comment type: PolySmooth";
+ break;
+ case 165: // PolyClose
+// qDebug() << "Comment type: PolyClose";
+ break;
+ case 170: // picArrw1 Arrowhead on 2nd point of line
+// qDebug() << "Comment type: picArrw1";
+ break;
+ case 171: // picArrw2 Arrowhead on 1nd point of line
+// qDebug() << "Comment type: picArrw2";
+ break;
+ case 172: // picArrw3 Arrowhead on both endpoints
+// qDebug() << "Comment type: picArrw3";
+ break;
+ case 173: // picArrwEnd End of arrowhead comment
+// qDebug() << "Comment type: picArrwEnd";
+ break;
+ case 180: // DashedLine
+// qDebug() << "Comment type: DashedLine";
+ break;
+ case 181: // DashedStop
+// qDebug() << "Comment type: DashedStop";
+ break;
+ case 182: // SetLineWidth
+// qDebug() << "Comment type: SetLineWidth";
+ break;
+ case 190: // PostScriptBegin
+ postscriptMode = true;
+// qDebug() << "Comment type: PostScriptBegin";
+ break;
+ case 191: // PostScriptEnd
+ postscriptMode = false;
+ textIsPostScript = false;
+// qDebug() << "Comment type: PostScriptEnd";
+ break;
+ case 192: // PostScriptHandle
+// qDebug() << "Comment type: PostScriptHandle";
+ break;
+ case 193: // PostScriptFile
+// qDebug() << "Comment type: PostScriptFile";
+ break;
+ case 194: // TextIsPostScript
+ textIsPostScript = true;
+// qDebug() << "Comment type: TextIsPostScript";
+ break;
+ case 195: // ResourcePS
+// qDebug() << "Comment type: ResourcePS";
+ break;
+ case 196: // PSBeginNoSave
+// qDebug() << "Comment type: PSBeginNoSave";
+ break;
+ case 200: // RotateBegin
+// qDebug() << "Comment type: RotateBegin";
+ break;
+ case 201: // RotateEnd
+// qDebug() << "Comment type: RotateEnd";
+ break;
+ case 210: // FormsPrinting
+// qDebug() << "Comment type: FormsPrinting";
+ break;
+ case 211: // EndFormsPrinting
+// qDebug() << "Comment type: EndFormsPrinting";
+ break;
+ case 220: // CMBeginProfile
+// qDebug() << "Comment type: CMBeginProfile";
+ break;
+ case 221: // CMEndProfile
+// qDebug() << "Comment type: CMEndProfile";
+ break;
+ case 222: // CMEnableMatching
+// qDebug() << "Comment type: CMEnableMatching";
+ break;
+ case 223: // CMDisableMatching
+// qDebug() << "Comment type: CMDisableMatching";
+ break;
+ default:
+// qDebug() << "Unknown Pict-Comment" << commentCode;
+ break;
+ }
+ if (longComment)
+ {
+ quint16 dataLen;
+ ts >> dataLen;
+ alignStreamToWord(ts, dataLen);
+ }
+}
+
+QRect PctPlug::readRect(QDataStream &ts)
+{
+ qint16 RectX, RectY, RectW, RectH;
+ ts >> RectX >> RectY >> RectW >> RectH;
+ return QRect(QPoint(RectY, RectX), QPoint(RectH, RectW));
+}
+
+QByteArray PctPlug::decodeRLE(QByteArray &in, quint16 bytesPerLine, int multByte)
+{
+ QByteArray ret = QByteArray(bytesPerLine, ' ');
+ uchar *ptrOut, *ptrIn;
+ ptrOut = (uchar*)ret.data();
+ ptrIn = (uchar*)in.data();
+ quint16 count = 0;
+ uchar c, c2;
+ quint16 len;
+ while( count < in.size() )
+ {
+ c = *ptrIn++;
+ count++;
+ len = c;
+ if( len < 128 )
+ {
+ // Copy next len+1 bytes literally.
+ len++;
+ len *= multByte;
+ while( len != 0 )
+ {
+ *ptrOut++ = *ptrIn++;
+ len--;
+ count++;
+ if (multByte == 2)
+ {
+ *ptrOut++ = *ptrIn++;
+ len--;
+ count++;
+ }
+ }
+ }
+ else if( len > 128 )
+ {
+ // Next -len+1 bytes in the dest are replicated from next source byte.
+ // (Interpret len as a negative 8-bit int.)
+ len ^= 0xFF;
+ len += 2;
+ len *= multByte;
+ if (multByte == 2)
+ {
+ c = *ptrIn++;
+ count++;
+ c2 = *ptrIn++;
+ count++;
+ while( len != 0 )
+ {
+ *ptrOut++ = c;
+ *ptrOut++ = c2;
+ len--;
+ len--;
+ }
+ }
+ else
+ {
+ c = *ptrIn++;
+ count++;
+ while( len != 0 )
+ {
+ *ptrOut++ = c;
+ len--;
+ }
+ }
+ }
+ else if( len == 128 )
+ {
+ // No-op.
+ }
+ }
+ return ret;
+}
+
+void PctPlug::setFillPattern(PageItem* ite)
+{
+ uint oldNum = m_Doc->TotalItems;
+ QString patternName;
+ quint32 patDat1, patDat2;
+ QDataStream bu(&patternData, QIODevice::ReadOnly);
+ bu >> patDat1 >> patDat2;
+ QString patNa = QString("%1%2%3%4").arg(backColor.name()).arg(foreColor.name()).arg(patDat1, 8, 16, QLatin1Char('0')).arg(patDat2, 8, 16, QLatin1Char('0'));
+ if (!patternMap.contains(patNa))
+ {
+ QImage image = QImage(8, 8, QImage::Format_Mono);
+ QVector<QRgb> colors;
+ colors.append(backColor.rgb());
+ colors.append(foreColor.rgb());
+ image.setColorTable(colors);
+ for (int rr = 0; rr < 8; rr++)
+ {
+ uchar *q = (uchar*)(image.scanLine(rr));
+ *q = patternData[rr];
+ }
+ image = image.convertToFormat(QImage::Format_ARGB32);
+ ScPattern pat = ScPattern();
+ pat.setDoc(m_Doc);
+ PageItem* newItem = new PageItem_ImageFrame(m_Doc, 0, 0, 1, 1, 0, CommonStrings::None, CommonStrings::None);
+ newItem->tempImageFile = new QTemporaryFile(QDir::tempPath() + "/scribus_temp_pct_XXXXXX.png");
+ newItem->tempImageFile->open();
+ QString fileName = getLongPathName(newItem->tempImageFile->fileName());
+ newItem->tempImageFile->close();
+ newItem->isInlineImage = true;
+ image.setDotsPerMeterY(2834);
+ image.setDotsPerMeterX(2834);
+ image.save(fileName, "PNG");
+ if (newItem->loadImage(fileName, false, 72, false))
+ {
+ pat.width = image.width();
+ pat.height = image.height();
+ pat.scaleX = (72.0 / newItem->pixm.imgInfo.xres) * newItem->pixm.imgInfo.lowResScale;
+ pat.scaleY = (72.0 / newItem->pixm.imgInfo.xres) * newItem->pixm.imgInfo.lowResScale;
+ pat.pattern = newItem->pixm.qImage().copy();
+ newItem->setWidth(pat.pattern.width());
+ newItem->setHeight(pat.pattern.height());
+ newItem->SetRectFrame();
+ newItem->gXpos = 0.0;
+ newItem->gYpos = 0.0;
+ newItem->gWidth = pat.pattern.width();
+ newItem->gHeight = pat.pattern.height();
+ pat.items.append(newItem);
+ newItem->ItemNr = pat.items.count();
+ }
+ patternName = "Pattern_"+newItem->itemName();
+ patternName = patternName.trimmed().simplified().replace(" ", "_");
+ m_Doc->addPattern(patternName, pat);
+ importedPatterns.append(patternName);
+ patternMap.insert(patNa, patternName);
+ }
+ else
+ patternName = patternMap[patNa];
+ ite->setPattern(patternName);
+ ite->GrType = 8;
+ m_Doc->TotalItems = oldNum;
+// qDebug() << "Using Pattern" << patternName << "internal Name" << patNa;
+}
+
+void PctPlug::handleLineModeEnd()
+{
+ if ((Coords.size() > 3) && lineMode)
+ {
+ int z = m_Doc->itemAdd(PageItem::PolyLine, PageItem::Unspecified, baseX, baseY, 10, 10, LineW, CommonStrings::None, CurrColorStroke, true);
+ PageItem *ite = m_Doc->Items->at(z);
+ ite->PoLine = Coords.copy();
+ ite->PoLine.translate(m_Doc->currentPage()->xOffset(), m_Doc->currentPage()->yOffset());
+ finishItem(ite);
+ }
+ Coords.resize(0);
+ Coords.svgInit();
+ lineMode = false;
+}
+
+void PctPlug::finishItem(PageItem* ite)
+{
+ ite->ClipEdited = true;
+ ite->FrameType = 3;
+ ite->setFillShade(CurrFillShade);
+ ite->setLineShade(CurrStrokeShade);
+ FPoint wh = getMaxClipF(&ite->PoLine);
+ ite->setWidthHeight(wh.x(),wh.y());
+ ite->setTextFlowMode(PageItem::TextFlowDisabled);
+ m_Doc->AdjustItemSize(ite);
+ ite->OldB2 = ite->width();
+ ite->OldH2 = ite->height();
+ ite->updateClip();
+ Elements.append(ite);
+ lastCoords = Coords;
+ Coords.resize(0);
+ Coords.svgInit();
+}
diff --git a/scribus/plugins/import/pct/importpct.h b/scribus/plugins/import/pct/importpct.h new file mode 100644 index 0000000..9fc6253 --- /dev/null +++ b/scribus/plugins/import/pct/importpct.h @@ -0,0 +1,146 @@ +/* +For general Scribus (>=1.3.2) copyright and licensing information please refer +to the COPYING file provided with the program. Following this notice may exist +a copyright and/or license notice that predates the release of Scribus 1.3.2 +for which a new license (GPL+exception) is in place. +*/ +#ifndef IMPORTPCT_H +#define IMPORTPCT_H + + +#include "pluginapi.h" +#include "pageitem.h" +#include "sccolor.h" +#include "fpointarray.h" +#include <QList> +#include <QTransform> +#include <QMultiMap> +#include <QtGlobal> +#include <QObject> +#include <QString> +#include <QRect> + +class MultiProgressDialog; +class ScribusDoc; +class Selection; +class TransactionSettings; + +//! \brief Pct (Mac Pict) importer plugin +class PctPlug : public QObject +{ + Q_OBJECT + +public: + /*! + \author Franz Schmid + \date + \brief Create the Pct importer window. + \param fName QString + \param flags combination of loadFlags + \param showProgress if progress must be displayed + \retval EPSPlug plugin + */ + PctPlug( ScribusDoc* doc, int flags ); + ~PctPlug(); + + /*! + \author Franz Schmid + \date + \brief Perform import. + \param fn QString + \param trSettings undo transaction settings + \param flags combination of loadFlags + \param showProgress if progress must be displayed + \retval bool true if import was ok + */ + bool import(QString fn, const TransactionSettings& trSettings, int flags, bool showProgress = true); + +private: + void parseHeader(QString fName, double &x, double &y, double &b, double &h); + bool convert(QString fn); + void parsePict(QDataStream &ts); + void alignStreamToWord(QDataStream &ts, uint len); + void handleColor(QDataStream &ts, bool back); + void handleColorRGB(QDataStream &ts, bool back); + void handlePenPattern(QDataStream &ts); + void handlePolygon(QDataStream &ts, quint16 opCode); + void handleShape(QDataStream &ts, quint16 opCode); + void handleSameShape(QDataStream &ts, quint16 opCode); + void handleFontName(QDataStream &ts); + void handleTextSize(QDataStream &ts); + void handleTextFont(QDataStream &ts); + void handleTextStyle(QDataStream &ts); + void handleLongText(QDataStream &ts); + void handleDHText(QDataStream &ts); + void handleDVText(QDataStream &ts); + void handleDHVText(QDataStream &ts); + void createTextPath(QByteArray textString); + void handlePenSize(QDataStream &ts); + void handleOvalSize(QDataStream &ts); + void handleShortLine(QDataStream &ts); + void handleShortLineFrom(QDataStream &ts); + void handleLine(QDataStream &ts); + void handleLineFrom(QDataStream &ts); + void handlePixmap(QDataStream &ts, quint16 opCode); + void handleQuickTime(QDataStream &ts, quint16 opCode); + void handleComment(QDataStream &ts, bool longComment); + QRect readRect(QDataStream &ts); + QByteArray decodeRLE(QByteArray &in, quint16 bytesPerLine, int twoByte); + void setFillPattern(PageItem* ite); + void handleLineModeEnd(); + void finishItem(PageItem* ite); + + QList<PageItem*> Elements; + int currentItemNr; + QStack<QList<PageItem*> > groupStack; + ColorList CustColors; + double baseX, baseY; + double docWidth; + double docHeight; + + double LineW; + QString CurrColorFill; + QColor backColor; + QString CurrColorStroke; + QColor foreColor; + double CurrStrokeShade; + double CurrFillShade; + bool patternMode; + QByteArray patternData; + QMap<QString, QString> patternMap; + QRect currRect; + int currRectItemNr; + int currRectType; + QRect lastImageRect; + QStringList importedColors; + QStringList importedPatterns; + QPoint ovalSize; + QMap<int, QString> fontMap; + int currentTextSize; + int currentFontID; + int currentFontStyle; + FPointArray lastCoords; + QByteArray imageData; + + FPointArray Coords; + QPoint currentPoint; + QPoint currentPointT; + bool lineMode; + bool postscriptMode; + bool textIsPostScript; + bool interactive; + MultiProgressDialog * progressDialog; + bool cancel; + ScribusDoc* m_Doc; + Selection* tmpSel; + int importerFlags; + int oldDocItemCount; + QString baseFile; + int pctVersion; + bool skipOpcode; + +public slots: + void cancelRequested() { cancel = true; } +}; + +#endif diff --git a/scribus/plugins/import/pct/importpctplugin.cpp b/scribus/plugins/import/pct/importpctplugin.cpp new file mode 100644 index 0000000..41e7acf --- /dev/null +++ b/scribus/plugins/import/pct/importpctplugin.cpp @@ -0,0 +1,155 @@ +/*
+For general Scribus (>=1.3.2) copyright and licensing information please refer
+to the COPYING file provided with the program. Following this notice may exist
+a copyright and/or license notice that predates the release of Scribus 1.3.2
+for which a new license (GPL+exception) is in place.
+*/
+#include "commonstrings.h"
+#include "customfdialog.h"
+#include "importpct.h"
+#include "importpctplugin.h"
+#include "menumanager.h"
+#include "page.h"
+#include "prefscontext.h"
+#include "prefsfile.h"
+#include "prefsmanager.h"
+#include "scraction.h"
+#include "scribuscore.h"
+#include "undomanager.h"
+#include "util_formats.h"
+
+
+int importpct_getPluginAPIVersion()
+{
+ return PLUGIN_API_VERSION;
+}
+
+ScPlugin* importpct_getPlugin()
+{
+ ImportPctPlugin* plug = new ImportPctPlugin();
+ Q_CHECK_PTR(plug);
+ return plug;
+}
+
+void importpct_freePlugin(ScPlugin* plugin)
+{
+ ImportPctPlugin* plug = dynamic_cast<ImportPctPlugin*>(plugin);
+ Q_ASSERT(plug);
+ delete plug;
+}
+
+ImportPctPlugin::ImportPctPlugin() : LoadSavePlugin(),
+ importAction(new ScrAction(ScrAction::DLL, "", QKeySequence(), this))
+{
+ // Set action info in languageChange, so we only have to do it in one
+ // place. This includes registering file format support.
+ languageChange();
+}
+
+void ImportPctPlugin::languageChange()
+{
+ importAction->setText( tr("Import Pict..."));
+ // (Re)register file format support
+ unregisterAll();
+ registerFormats();
+}
+
+ImportPctPlugin::~ImportPctPlugin()
+{
+ unregisterAll();
+};
+
+const QString ImportPctPlugin::fullTrName() const
+{
+ return QObject::tr("Pict Importer");
+}
+
+
+const ScActionPlugin::AboutData* ImportPctPlugin::getAboutData() const
+{
+ AboutData* about = new AboutData;
+ about->authors = "Franz Schmid <franz@scribus.info>";
+ about->shortDescription = tr("Imports Pict Files");
+ about->description = tr("Imports most Mac Pict files into the current document,\nconverting their vector data into Scribus objects.");
+ about->license = "GPL";
+ Q_CHECK_PTR(about);
+ return about;
+}
+
+void ImportPctPlugin::deleteAboutData(const AboutData* about) const
+{
+ Q_ASSERT(about);
+ delete about;
+}
+
+void ImportPctPlugin::registerFormats()
+{
+ FileFormat fmt(this);
+ fmt.trName = FormatsManager::instance()->nameOfFormat(FormatsManager::PCT); // Human readable name
+ fmt.formatId = FORMATID_PCTIMPORT;
+ fmt.filter = FormatsManager::instance()->extensionsForFormat(FormatsManager::PCT); // QFileDialog filter
+ fmt.nameMatch = QRegExp("\\."+FormatsManager::instance()->extensionListForFormat(FormatsManager::PCT, 1)+"$", Qt::CaseInsensitive);
+ fmt.load = true;
+ fmt.save = false;
+ fmt.mimeTypes = FormatsManager::instance()->mimetypeOfFormat(FormatsManager::PCT); // MIME types
+ fmt.priority = 64; // Priority
+ registerFormat(fmt);
+}
+
+bool ImportPctPlugin::fileSupported(QIODevice* /* file */, const QString & fileName) const
+{
+ return true;
+}
+
+bool ImportPctPlugin::loadFile(const QString & fileName, const FileFormat &, int flags, int /*index*/)
+{
+ // There's only one format to handle, so we just call import(...)
+ return import(fileName, flags);
+}
+
+bool ImportPctPlugin::import(QString fileName, int flags)
+{
+ if (!checkFlags(flags))
+ return false;
+ if( fileName.isEmpty() )
+ {
+ flags |= lfInteractive;
+ PrefsContext* prefs = PrefsManager::instance()->prefsFile->getPluginContext("importpct");
+ QString wdir = prefs->get("wdir", ".");
+ CustomFDialog diaf(ScCore->primaryMainWindow(), wdir, QObject::tr("Open"), tr("All Supported Formats")+" (*.pct *.PCT *.pict *.PICT);;All Files (*)");
+ if (diaf.exec())
+ {
+ fileName = diaf.selectedFile();
+ prefs->set("wdir", fileName.left(fileName.lastIndexOf("/")));
+ }
+ else
+ return true;
+ }
+ m_Doc=ScCore->primaryMainWindow()->doc;
+ UndoTransaction* activeTransaction = NULL;
+ bool emptyDoc = (m_Doc == NULL);
+ bool hasCurrentPage = (m_Doc && m_Doc->currentPage());
+ TransactionSettings trSettings;
+ trSettings.targetName = hasCurrentPage ? m_Doc->currentPage()->getUName() : "";
+ trSettings.targetPixmap = Um::IImageFrame;
+ trSettings.actionName = Um::ImportXfig;
+ trSettings.description = fileName;
+ trSettings.actionPixmap = Um::IXFIG;
+ if (emptyDoc || !(flags & lfInteractive) || !(flags & lfScripted))
+ UndoManager::instance()->setUndoEnabled(false);
+ if (UndoManager::undoEnabled())
+ activeTransaction = new UndoTransaction(UndoManager::instance()->beginTransaction(trSettings));
+ PctPlug *dia = new PctPlug(m_Doc, flags);
+ Q_CHECK_PTR(dia);
+ dia->import(fileName, trSettings, flags);
+ if (activeTransaction)
+ {
+ activeTransaction->commit();
+ delete activeTransaction;
+ activeTransaction = NULL;
+ }
+ if (emptyDoc || !(flags & lfInteractive) || !(flags & lfScripted))
+ UndoManager::instance()->setUndoEnabled(true);
+ delete dia;
+ return true;
+}
diff --git a/scribus/plugins/import/pct/importpctplugin.h b/scribus/plugins/import/pct/importpctplugin.h new file mode 100644 index 0000000..f6a65d3 --- /dev/null +++ b/scribus/plugins/import/pct/importpctplugin.h @@ -0,0 +1,57 @@ +/* +For general Scribus (>=1.3.2) copyright and licensing information please refer +to the COPYING file provided with the program. Following this notice may exist +a copyright and/or license notice that predates the release of Scribus 1.3.2 +for which a new license (GPL+exception) is in place. +*/ +#ifndef IMPORTPCTPLUGIN_H +#define IMPORTPCTPLUGIN_H + +#include "pluginapi.h" +#include "loadsaveplugin.h" +#include "../../formatidlist.h" + +class ScrAction; + +class PLUGIN_API ImportPctPlugin : public LoadSavePlugin +{ + Q_OBJECT + + public: + // Standard plugin implementation + ImportPctPlugin(); + virtual ~ImportPctPlugin(); + /*! + \author Franz Schmid + \date + \brief Returns name of plugin + \retval QString containing name of plugin: Import EPS/PDF/PS... + */ + virtual const QString fullTrName() const; + virtual const AboutData* getAboutData() const; + virtual void deleteAboutData(const AboutData* about) const; + virtual void languageChange(); + virtual bool fileSupported(QIODevice* file, const QString & fileName=QString::null) const; + virtual bool loadFile(const QString & fileName, const FileFormat & fmt, int flags, int index = 0); + virtual void addToMainWindowMenu(ScribusMainWindow *) {}; + + public slots: + /*! + \author Franz Schmid + \date + \brief Run the EPS import + \param fileName input filename, or QString::null to prompt. + \retval bool always true + */ + virtual bool import(QString fileName = QString::null, int flags = lfUseCurrentPage|lfInteractive); + + private: + void registerFormats(); + ScrAction* importAction; +}; + +extern "C" PLUGIN_API int importpct_getPluginAPIVersion(); +extern "C" PLUGIN_API ScPlugin* importpct_getPlugin(); +extern "C" PLUGIN_API void importpct_freePlugin(ScPlugin* plugin); + +#endif |
