| Commit message (Collapse) | Author | Age | Files | Lines |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Hi,
Changelog of v6:
================
* The definations of CGROUP_RULE_MAXKEY and CGROUP_RULE_MAXLINE are
moved to libcgroup-internal.h since no one from outside should be
using them.
Changelog of v5:
================
* Rebase the patch to the latest code.
Changelog of v4:
================
* Use more safety length of a user name for the buffer "username".
* Move the macros min()/max() to src/libcgroup-internal.h for using
in src/api.c also.
Changelog of v3:
================
* Fix unclear buffer of user by memset().
Changelog of v2:
================
* Remove unnecessary memset().
* Some cleanups.
Description:
============
This patch adds the parser of process name in /etc/cgrules.conf.
A new rule based on process name is as the following, and the process
name is stored into the member "procname" in struct cgroup_rule.
<user>:<process name> <controllers> <destination>
Thanks
Ken'ichi Ohmichi
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Hi,
Changelog of v6:
================
* Change the returning values of *_get_procname_from_proc*() to integer
from charactor pointer.
* Clarify the number meaning of string length in cg_get_procname_from_
~proc_status()
Changelog of v5:
================
* Rebase the patch to the latest code.
Changelog of v4:
================
* Add the error handling for strdup()'s error.
* Reduce strlen() calls.
* Make the check code of a process name simple.
Changelog of v3:
================
* Move cgroup_get_procname_from_procfs() to libcgroup-internal.h.
* Fix unclear buffer of buf_cwd by memset().
* Get a real path of script file by realpath().
Changelog of v2:
================
* It is possible to handle a process, which name length is over than
16 characters, also.
Description:
============
This patch adds a new function cgroup_get_procname_from_procfs()
for getting a process name.
This function allocates the memory for a process name, and writes
the name to the memory, and returns the pointer of the memory.
So a caller should free the memory if unusing it.
The process name, which is wrotten by this function, depends on
the specified process:
If a command process) the full path of command.
If a shell script process) the full path of shell script.
If a kernel thread) the process name of kernel thread.
Thanks
Ken'ichi Ohmichi
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
| |
The test case to test the new mount point API.
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
| |
Introduce an API which will query the mount table and return the mount point
of a specific subsystem. This is needed in the case when the user knows which
subsystem he wants the details of, which would make the use of the get_controller*
APIs cumbersome.
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Hi,
The latest source (commit: 5ea9a7819b717a83af03aa2ea234f105ed717589)
outputs some following warnings:
$ make
[snip]
api.c: In function 'cgroup_walk_tree_begin':
api.c:2350: warning: passing argument 3 of 'cg_walk_node' makes integer from pointer without a cast
api.c:2315: warning: unused variable 'fts'
[snip]
$
This patch fixes them.
Thanks
Ken'ichi Ohmichi
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Acked-by: Balbir Singh <balbir@linux.vnet.ibm.com>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
| |
Jan pointed out that there was a goto missing in the error
handling paths. Fix that bug.
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
This API will unload the cgroups created in the cgroupfs and
unmount and delete the filesystem mount point. The action is
equivalent to what is done currently in service cgconfig stop.
The reason for this API is to make sure we don't end up with a
asymmetric library API subset. Today an application program can
programatically through cgroup_config_load_config() load a
configuration file, but has no means to cleanup (including all
temporarily created groups).
changes from v3
1. Address Jan's comments from http://article.gmane.org/gmane.comp.lib.libcg.devel/1105
changes from v2
1. Fix a leak as noted by Bharata
2. Address Balbir's review comments at
http://article.gmane.org/gmane.comp.lib.libcg.devel/1080
changes from v1
1. Change the name of the function to cgroup_unload_cgroups
2. Change the name of the executatble to cgclear
3. Split out the funtions
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
Acked-by: Balbir Singh <balbir@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
This set of APIs will allow the caller to query the mount table
and find out what controller is mounted at what path.
Test program has been included in the patch. Running the test program
results in
[dhaval@gondor tests]$ ../libtool --mode=execute ./get_controller
Controller cpu is mounted at /cgroup
Controller cpuacct is mounted at /cgroup
Controller memory is mounted at /cgroup1
[dhaval@gondor tests]$
Which is the setup on this system.
Changes from v2
1. Remove the incorrect comments as pointed out by Bharata
Changes from v1
1. Use a new structure as mentioned by bharata to return the values.
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
Cc: Jan Safranek <jsafrane@redhat.com>
Acked-by: Bharata B Rao <bharata@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
| |
As Jan Safranek pointed out, it is better to have double pointers
everywhere in the get_task API to keep consistency. Do the same.
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
Acked-by: Balbir Singh <balbir@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
| |
With the introduction of the flags, we now actually make use of them.
This patch adds a post mode and modifies the test case to also do a post
order walk.
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
Acked-by: Balbir Singh <balbir@linux.vnet.ibm.com>
Acked-by: Bharata B Rao <bharata@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Introduce a cgroup_tree_handle structure so that we can track flags for
the walk_tree operation. In a number of cases we would prefer to walk the
tree in postorder as opposed to pre-order which is the current default.
This patch does the addition.
Changes since V1:
1. Added checks for !handle as suggested by Bharata
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
Acked-by: Balbir Singh <balbir@linux.vnet.ibm.com>
Acked-by: Bharata B Rao <bharata@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
| |
https://bugzilla.redhat.com/show_bug.cgi?id=502687 mentioned that the directory
was not getting created when a cgconfig start was being run.
This is was because we failed the mkdir. The mkdir for directories at depth
was not succeeding.
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
Acked-by: Balbir Singh <balbir@linux.vnet.ibm.com>
|
|
|
|
|
|
|
| |
This patch adds cgset man page - it includes Makefile changes
Signed-off-by: Ivana Varekova <varekova@redhat.com>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
This patch adds cgset tool, which sets parameters of controllers
for given cgroup based on input name-variable pairs
- the syntax is:
cgset -r <name=value> <relative path to cgroup>
-------------------------------------------------
EXAMPLES:
$ cgcreate -g cpuset:test1
$ cgset -r cpuset.cpus=1 test
$ cat ./test/cpuset.cpus
1
$ cgcreate -g cpuset:test1 -g cpuset:test2
$ cgset -r cpuset.cpus=0 test1 test2
$ cat /mnt/cgroups/cpuset/test1/cpuset.cpus
0
$ cat /mnt/cgroups/cpuset/test2/cpuset.cpus
0
Signed-off-by: Ivana Varekova <varekova@redhat.com>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
| |
This patche add a test to cgroup_init function, which prevent to add
multiple records for the same controller (this is a problem eg. in
cgroup_get_cgroup function - which looks to mount table and add all
relevant controllers using cgroup_add_controller function and when the
function calls cgroup_add_cgroup function twice on the same controller,
it returns error so the result is cgroup_get_cgroup failed).
Signed-off-by: Ivana Varekova <varekova@redhat.com>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
CHANGELOG of v2.1:
================
* Rebase the patch for commit '340feae163c4797a6cb1247b3812c1ccdc52fa41'.
There are some similar functions for getting process's data (uid, gid) from
/proc/<pid>/status file, so this patch integrates these functions into one
cgroup_get_uid_gid_from_procfs().
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Reviewed-By: Jan Safranek <jsafrane@redhat.com>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Hi,
CHANGELOG of v2:
================
* New patch.
Thanks
Ken'ichi Ohmichi
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Reviewed-By: Jan Safranek <jsafrane@redhat.com>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Hi,
CHANGELOG of v2:
================
* No change.
To add the member "procname" to struct cgroup_rule by later patch, this
patch renames the member "name" to "username" for the clarification.
Thanks
Ken'ichi Ohmichi
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Reviewed-By: Jan Safranek <jsafrane@redhat.com>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Hi,
CHANGELOG of v2:
================
* No change.
The loop in cgroup_parse_rules() is a little long now, and it is not
easy to read the loop.
Then, This patch shortens the loop for the readability.
Thanks
Ken'ichi Ohmichi
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Reviewed-By: Jan Safranek <jsafrane@redhat.com>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Changelog of v3:
================
* Remove unnecessary memset().
fgets()/sscanf() does not care what is in the buffer, and it is
unnecessary to clear the buffer before.
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Reviewed-By: Jan Safranek <jsafrane@redhat.com>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Hi,
CHANGELOG of v2:
================
* Specify the buffer size of 'user' instead of strlen().
It actually walks through 'user' twice, once to compute length by
strlen() and then this patch specifies the buffer size of 'user' instead.
Reported-by: Jan Safranek <jsafrane@redhat.com>
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Reviewed-By: Jan Safranek <jsafrane@redhat.com>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
| |
This patch adds cgcreate man page - it includes Makefile.in changes
Signed-off-by: Ivana Varekova <varekova@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
This patch adds cgcreate tool, which creates cgroups based on input
parameters - the syntax is:
cgcreate -t <tuid>:<tgid> -a <agid>:<auid> -g <list of
controllers>:<relative path to cgroup>
where:
-a enables user to define admin gid and uid (implicit values are the
same values which are in the parent directory)
-t enables user to define task gid and uid (implicit values are the
same values which are in parent directory)
-g sets pairs list of controllers-relative path to cgroup
-------------------------------------------------
EXAMPLES:
* ../../libtool --mode=execute ./cgcreate -a :varekova -g cpuacct:first
* ll /mnt/cgroups/cpuacct | grep first
drwxrwxr-x 2 root varekova 0 2009-06-03 09:14 first
* ll /mnt/cgroups/cpuacct/first/*
-rwxrwxr-x 1 root varekova 0 2009-06-03 09:14 /mnt/cgroups/cpuacct/first/cpuacct.usage
-rwxrwxr-x 1 root varekova 0 2009-06-03 09:14 /mnt/cgroups/cpuacct/first/notify_on_release
-rwxrwxr-x 1 root varekova 0 2009-06-03 09:14 /mnt/cgroups/cpuacct/first/tasks
* ../../libtool --mode=execute ./cgcreate -a varekova:root -t varekova:varekova -g cpuacct:second
* ll /mnt/cgroups/cpuacct/ | grep second
drwxrwxr-x 2 varekova root 0 2009-06-03 09:13 second
* ll /mnt/cgroups/cpuacct/second
total 0
-rwxrwxr-x 1 varekova root 0 2009-06-03 09:13 cpuacct.usage
-rwxrwxr-x 1 varekova root 0 2009-06-03 09:13 notify_on_release
-rwxrwxr-x 1 varekova varekova 0 2009-06-03 09:13 tasks
* ../../libtool --mode=execute ./cgcreate -a varekova:varekova -g cpuacct:third -g cpuacct:fourth
* ll /mnt/cgroups/cpuacct | grep h
drwxrwxr-x 2 varekova varekova 0 2009-06-03 09:18 fourth
drwxrwxr-x 2 varekova varekova 0 2009-06-03 09:18 third
* ll /mnt/cgroups/cpuacct/*h*
/mnt/cgroups/cpuacct/fourth:
total 0
-rwxrwxr-x 1 varekova varekova 0 2009-06-03 09:18 cpuacct.usage
-rwxrwxr-x 1 varekova varekova 0 2009-06-03 09:18 notify_on_release
-rwxrwxr-x 1 varekova varekova 0 2009-06-03 09:18 tasks
/mnt/cgroups/cpuacct/third:
total 0
-rwxrwxr-x 1 varekova varekova 0 2009-06-03 09:18 cpuacct.usage
-rwxrwxr-x 1 varekova varekova 0 2009-06-03 09:18 notify_on_release
-rwxrwxr-x 1 varekova varekova 0 2009-06-03 09:18 tasks
Signed-off-by: Ivana Varekova <varekova@redhat.com>
|
|
|
|
|
|
|
|
|
| |
libcgroup: Export cgroup_get_controller API
This wrapper was not exposed for some reason earlier. Make it available
from the library.
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
| |
Add cgroup_free_group_spec procedure which free cgroups_group_spec
variable.
Signed-off-by: Ivana Varekova <varekova@redhat.com>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
| |
parse_cgroup_spec function does not initializesd allocated memory
this patch allocate it to zero so there is no problem with uninitialized
values.
Signed-off-by: Ivana Varekova <varekova@redhat.com>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|\ |
|
| |
| |
| |
| |
| |
| |
| | |
When PAM module is enabled, configure script should check if
necessary headers and libraries are available.
Signed-off-by: Jan Safranek <jsafrane@redhat.com>
|
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | |
By default, everything is compiled. I want to add options to ./configure,
which can selectively disable tools, daemon and pam module. The library
itself is mandatory component and cannot be disabled.
Usage:
./configure --help
./configure --disable-tools --disable-pam --disable-daemon
Signed-off-by: Jan Safranek <jsafrane@redhat.com>
|
|/
|
|
|
|
|
| |
File named 'missing' is generated by automake (or libtool?), it's not
necessary to have it in git.
Signed-off-by: Jan Safranek <jsafrane@redhat.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
fix the problem - can be applied now :)
configure.in file wrongly handles YACC and LEX variables so ./configure
exit succesfully, but make fails.
The problems are:
* it enables configuration even if no yacc is installed (it is necessary
for make) - YACC is set to byacc in this case
* the configure.in enables configuration if no lex is installed (it is
again necessary for succesfull make) - in this case YAC is set to ":" i
Signed-off-by: Ivana Varekova <varekova@redhat.com>
Acked-by: Jan Safranek <jsafrane@redhat.com>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Hi,
Changelog of v2:
- Add the description of the problematic call sequence.
- There is not any change in the code.
[PATCH-v2] Fix the deadlock of rl_lock.
For avoiding the deadlock, protect cdgroup_change_cgroup_uid_gid_flags()
by blocking SIGUSR2 signal.
The problematic call sequence is the following:
----------------------------------------------------------------------
* CGRULESENGD DAEMON *
<< cgre_flash_rules() is the signal handler for SIGUSR2 signal >>
cgre_create_netlink_socket_process_msg()
<< Receive a UID/GID event packet >>
cgre_handle_msg()
cgre_process_event()
cgroup_change_cgroup_uid_gid_flags()
cgroup_find_matching_rule_uid_gid()
pthread_rwlock_wrlock(&rl_lock); << Get the lock of rl_lock >>
<< Receive a SIGUSR2 signal, and switch to cgre_flash_rules() >>
cgre_flash_rules()
cgroup_reload_cached_rules()
cgroup_parse_rules()
pthread_rwlock_wrlock(&rl_lock); << deadlock ! >>
----------------------------------------------------------------------
A cgrulesengd daemon needs a lock of rl_lock for referring configuration
buffer. On the other way, the daemon reloads configuration file when
receiving SIGUSR2 signal, and it needs the same lock in cgroup_parse_rules().
So cgroup_change_cgroup_uid_gid_flags() should be protected from SIGUSR2
signal for avoiding the deadlock.
Thanks
Ken'ichi Ohmichi
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Hi,
I found the deadlock problem that a cgrulesengd daemon stalls if
service "cgred" is reloaded while many UID events happen.
The following is the gdb output by attaching the stalling daemon:
(gdb) bt
#0 0x0000003b298dd918 in __lll_mutex_lock_wait () from /lib64/libc.so.6
#1 0x0000003b298ce847 in _L_lock_646 () from /lib64/libc.so.6
#2 0x0000003b298ce2da in __vsyslog_chk () from /lib64/libc.so.6
#3 0x0000000000401533 in flog (level=5, format=0x402778 "Reloading rules configuration.") at cgrule sengd.c:130
#4 0x00000000004015d1 in cgre_flash_rules (signum=<value optimized out>) at cgrulesengd.c:644
#5 <signal handler called>
#6 0x0000003b298d27b5 in send () from /lib64/libc.so.6
#7 0x0000003b298ce3a0 in __vsyslog_chk () from /lib64/libc.so.6
#8 0x0000000000401533 in flog (level=4, format=0x402b82 "Failed to open %s") at cgrulesengd.c:130
#9 0x0000000000401cc7 in cgre_process_event (ev=0x7fff8ad11cc4, type=4) at cgrulesengd.c:161
#10 0x0000000000401fd5 in cgre_create_netlink_socket_process_msg () at cgrulesengd.c:486
#11 0x00000000004023ca in main (argc=1, argv=<value optimized out>) at cgrulesengd.c:878
(gdb)
We can see __vsyslog_chk() is called twice, because the daemon
recieved a SIGUSR2 signal in __vsyslog_chk(). In __vsyslog_chk(),
"syslog_lock" is locked by __libc_lock_lock(syslog_lock).
So I think vsyslog() should be protected by blocking the signal,
and this patch fixes the problem by doing it.
Thanks
Ken'ichi Ohmichi
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Hi,
This patch clarifies the infinite loop.
Thanks
Ken'ichi Ohmichi
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Acked-by: Balbir Singh <balbir@linux.vnet.ibm.com>
Acked-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Hi,
This patch makes the indent of cgroup_init() shallower for the readability.
Thanks
Ken'ichi Ohmichi
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Acked-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Hi,
This patch adds necessary fclose() calls into egid_of_pid().
Thanks
Ken'ichi Ohmichi
Reported-by: Masayuki Igawa <igawa@mxs.nes.nec.co.jp>
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
libcgrouptest: Fix the cgroup_dbg macro
On compiling with CGROUP_DEBUG enabled, compile was failing.
libcgrouptest01.c: In function ‘main’:
libcgrouptest01.c:57: error: expected ‘)’ before ‘...’ token
libcgrouptest01.c:64: error: expected ‘)’ before ‘...’ token
libcgrouptest01.c:68: error: expected ‘)’ before ‘...’ token
make[2]: *** [libcgrouptest01.o] Error 1
Fix this error.
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Hi,
I installed libcgroup by `make install`, and the service "cgred"
didn't work like the following:
# service cgred start
Starting CGroup Rules Engine Daemon...
/bin/bash: cgrulesengd: command not found
[FAILED]
#
The cause is why the function "daemon" cannot find cgrulesengd
command. This patch fixes the problem by specifying the full path
of cgrulesengd command.
Thanks
Ken'ichi Ohmichi
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Hi,
If failing to open /etc/cgrules.conf in cgroup_parse_rules(), rl_lock
should be unlocked. This patch fixes the code for doing it.
Thanks
Ken'ichi Ohmichi
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
| |
Signed-off-by: Masayuki Igawa <igawa@mxs.nes.nec.co.jp>
Signed-off-by: Balbir Singh <balbir@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
because the function breaks just after getting Uid data:
$ cat /proc/$$/status
[snip]
Uid: 500 500 500 500
Gid: 500 500 500 500
[snip]
$
This patch fixes this problem.
Signed-off-by: Masayuki Igawa <igawa@mxs.nes.nec.co.jp>
Signed-off-by: Balbir Singh <balbir@linux.vnet.ibm.com>
|
|
|
|
|
|
|
| |
Change the binary path for cgred to sbindir
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Change the hardcoded paths in initscripts to dynamically generated ones. The
real executable path $bindir can be constructed using $prefix and $exec_prefix
variables, therefore it's necessary to define also these two.
The patch includes removal of old initscripts from git - they are generated
from .in file now.
I did not run autoreconf, I think the generated junk is being removed from git
soon.
Signed-off-by: Jan Safranek <jsafrane@redhat.com>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
| |
For now the result is eg.:
Cgroup generic error, see errno: error message: No such file or directory
this patch remove outdated "see errno: " part.
second version
Signed-off-by: Ivana Varekova <varekova@redhat.com>
Acked-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
| |
Fix of cgexec error handling - with this patch cgexec return the right
error message - not only cg internal error value
re-generated
Signed-off-by: Ivana Varekova <varekova@redhat.com>
Acked-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
in long time. And the daemon was killed by an OOM killer. So the
daemon has memory leak. This patch fixes this problem.
The daemon allocates memory at cg_prepare_cgroup(), but it does not
free the memory. This patch adds necessary free() to cgroup_change_
cgroup_path by calling cgroup_free_controllers(). In addition, this
patch adds free()s for handling error and flushes the counters of the
allocations in cgroup_free_controllers().
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Signed-off-by: Balbir Singh <balbir@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
* Use clock_gettime(2) for getting timestamp since a system boot.
* Change parent_info's memory to dynamic allocation.
This patch is for changing the cgroup of a forked process while parent
changing.
This patch adds the following sequence:
1. Store both the timestamp and the process-id when changing the cgroup.
2. If receiving a PROC_EVENT_FORK packet, check its parent-pid and its
timestamp.
3. If its parent-pid and the stored process-id are same and its timestamp
is older than the stored timestamp, change the cgroup of forked process.
Thanks
Ken'ichi Ohmichi
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Signed-off-by: Balbir Singh <balbir@linux.vnet.ibm.com>
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
change the cgroup of child occasionally. I tested it by following
configulation file:
/etc/cgrules.conf:
user01 cpuset group01/user01
% memory group01/user01
A cpuset subsystem and a memory subsystem are mounted on different
mount points, and a cgrulesengd daemon manages each subsystem.
I login this environment as a user "user01", and each susbystem's
tasks file is the following:
# cat /mnt/cgroups/cpuset/group01/user01/tasks
31801
31805
31806
#
# cat /mnt/cgroups/memory/group01/user01/tasks
31801
31805
#
# pstree -p 32105
sshd(31801)---sshd(31805)---bash(31806)
#
They should be the same, but they are different. I investigated this
problem, and I found the cause. The reason is that the process(31806)
was forked just after writing the process(31805) to a cpuset subsystem's
tasks file:
<1> The UID/GID CHANGE event of the process 31805 happens.
<2> The daemon writes "31805" to a cpuset subsystem's tasks file.
<3> The process 31806 is forked, and it appears on a cpuset subsystem's
tasks file.
<4> The daemon writes "31805" to a memory subsystem's tasks file.
<5> The process 31806 does not appears on a memory subsystem's tasks file.
For solving this problem, I propose the following sequence.
1. Store both the timestamp and the process-id when the step <4>.
2. If receiving a PROC_EVENT_FORK packet, check its parent-pid and its
timestamp.
3. If its parent-pid and the stored process-id are same and its timestamp
is older than the stored timestamp, change the cgroup of forked process.
Changelog of v2:
* Change only [PATCH 2/2] and there is not any changes in [PATCH 1/2].
This patch adds the method for getting euid/egid from /proc/<pid>/status
file.
For changing the cgroup of a forked process, the method is usefull because
a PROC_EVENT_FORK packet does not inform of its euid and its egid.
Signed-off-by: Ken'ichi Ohmichi <oomichi@mxs.nes.nec.co.jp>
Signed-off-by: Balbir Singh <balbir@linux.vnet.ibm.com>
|
|\
| |
| |
| | |
ssh://balbir_singh@libcg.git.sourceforge.net/gitroot/libcg
|
| |
| |
| |
| |
| |
| |
| | |
These APIs were not available in v0.33. They will be a part of
v0.34 however. Make the change in libcgroup.map reflecting this.
Signed-off-by: Dhaval Giani <dhaval@linux.vnet.ibm.com>
|